The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(4-acetamidophenyl)-4-amino-7-oxo-6,7-dihydro-2H-pyrazolo[3,4-d]pyridazin-3-yl)-3-methyl-N-(3-(trifluoromethyl)phenyl)benzofuran-6-carboxamide ID: ALA5076889
PubChem CID: 166626921
Max Phase: Preclinical
Molecular Formula: C30H22F3N7O4
Molecular Weight: 601.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(-n2nc3c(=O)[nH]nc(N)c3c2-c2oc3cc(C(=O)Nc4cccc(C(F)(F)F)c4)ccc3c2C)cc1
Standard InChI: InChI=1S/C30H22F3N7O4/c1-14-21-11-6-16(28(42)36-19-5-3-4-17(13-19)30(31,32)33)12-22(21)44-26(14)25-23-24(29(43)38-37-27(23)34)39-40(25)20-9-7-18(8-10-20)35-15(2)41/h3-13H,1-2H3,(H2,34,37)(H,35,41)(H,36,42)(H,38,43)
Standard InChI Key: GMVAILVBISMMBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
10.2991 -10.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7565 -12.1466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4725 -12.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3836 -4.4346 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1929 -3.6656 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.3967 -3.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2630 -12.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5509 -11.8858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9076 -5.9978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7368 -5.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0181 -10.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5513 -11.0603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4644 -7.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8220 -3.0737 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.1822 -3.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3525 -4.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9803 -11.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9956 -3.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9548 -4.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8033 -8.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2936 -6.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7813 -4.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0232 -8.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5088 -6.2936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2972 -12.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2487 -7.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7616 -10.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4713 -10.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2790 -9.8309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4758 -10.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2595 -13.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2713 -10.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7136 -11.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0631 -11.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9834 -11.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8556 -7.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5355 -9.3705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8042 -9.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4155 -8.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2395 -11.4872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5308 -11.4999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9376 -12.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7548 -12.2107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5272 -12.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 16 2 0
38 20 1 0
15 6 2 0
6 22 1 0
32 29 1 0
35 32 1 0
8 12 1 0
23 20 2 0
18 5 1 0
8 7 1 0
21 24 2 0
22 18 1 0
20 39 1 0
35 17 1 0
13 36 2 0
23 37 1 0
9 10 1 0
32 12 2 0
37 11 1 0
16 15 1 0
18 4 1 0
27 11 1 0
26 13 1 0
18 14 1 0
7 17 1 0
19 10 1 0
25 33 2 0
11 38 2 0
1 30 2 0
13 21 1 0
2 40 1 0
36 23 1 0
17 2 2 0
33 1 1 0
40 34 1 0
21 9 1 0
7 31 2 0
38 28 1 0
22 19 2 0
39 26 2 0
30 34 1 0
34 3 2 0
3 25 1 0
40 27 1 0
27 35 2 0
33 41 1 0
41 42 1 0
42 43 2 0
42 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.55Molecular Weight (Monoisotopic): 601.1685AlogP: 5.64#Rotatable Bonds: 5Polar Surface Area: 160.93Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.72CX Basic pKa: 0.75CX LogP: 4.02CX LogD: 4.01Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.20Np Likeness Score: -1.29
References 1. Tan X, Li C, Yang R, Zhao S, Li F, Li X, Chen L, Wan X, Liu X, Yang T, Tong X, Xu T, Cui R, Jiang H, Zhang S, Liu H, Zheng M.. (2022) Discovery of Pyrazolo[3,4-d ]pyridazinone Derivatives as Selective DDR1 Inhibitors via Deep Learning Based Design, Synthesis, and Biological Evaluation., 65 (1.0): [PMID:34821145 ] [10.1021/acs.jmedchem.1c01205 ]