5-(Hydroxymethyl)-5-(((5-methylisoxazol-3-yl)oxy)methyl)-3-(propan-2-ylidene)dihydrofuran-2(3H)-one

ID: ALA5077794

PubChem CID: 166626883

Max Phase: Preclinical

Molecular Formula: C13H17NO5

Molecular Weight: 267.28

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)=C1CC(CO)(COc2cc(C)on2)OC1=O

Standard InChI:  InChI=1S/C13H17NO5/c1-8(2)10-5-13(6-15,18-12(10)16)7-17-11-4-9(3)19-14-11/h4,15H,5-7H2,1-3H3

Standard InChI Key:  PALLWDZPEHBEDT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   11.2830   -6.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1080   -6.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6991   -5.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3622   -7.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1870   -7.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4439   -6.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7746   -6.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2289   -6.3536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6712   -8.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3348   -8.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8670   -7.3122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1152   -5.1750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4918   -7.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7064   -4.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0442   -3.7090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4339   -3.1539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7173   -3.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8849   -4.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9653   -3.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  2  4  1  0
  6  8  2  0
  5  9  2  0
  9 10  1  0
  1 11  1  0
  3 12  1  0
  9 13  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 17 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5077794

    ---

Associated Targets(Human)

PRKCE Tchem Protein kinase C epsilon (1520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCA Tchem Protein kinase C alpha (5923 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 267.28Molecular Weight (Monoisotopic): 267.1107AlogP: 1.38#Rotatable Bonds: 4
Polar Surface Area: 81.79Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.56CX LogD: 1.56
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.66Np Likeness Score: 0.59

References

1. Elhalem E, Bellomo A, Cooke M, Scravaglieri A, Pearce LV, Peach ML, Gandolfi Donadío L, Kazanietz MG, Comin MJ..  (2021)  Design, Synthesis, and Characterization of Novel sn-1 Heterocyclic DAG-Lactones as PKC Activators.,  64  (15.0): [PMID:34279947] [10.1021/acs.jmedchem.1c00739]

Source