N-(4-((4-(trifluoromethyl)phenyasulfonamido)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5077837

PubChem CID: 166626368

Max Phase: Preclinical

Molecular Formula: C18H12F3N3O6S

Molecular Weight: 455.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1)c1ccc([N+](=O)[O-])o1

Standard InChI:  InChI=1S/C18H12F3N3O6S/c19-18(20,21)11-1-7-14(8-2-11)31(28,29)23-13-5-3-12(4-6-13)22-17(25)15-9-10-16(30-15)24(26)27/h1-10,23H,(H,22,25)

Standard InChI Key:  WBRDVAINOCNIGW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   50.0880  -26.2739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   49.8776  -25.4856    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   49.3001  -26.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.1448  -27.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9620  -27.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2164  -26.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5534  -26.5133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8947  -26.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1150  -26.7410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5080  -27.2881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.9447  -25.9418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.9939  -26.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6004  -27.2916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.1649  -25.9449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.9425  -25.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.5473  -26.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.3242  -25.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.4958  -25.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.8844  -24.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.1098  -24.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.2731  -24.9392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   50.6575  -25.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.2620  -25.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.0413  -25.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.2136  -24.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.6004  -24.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   50.8234  -24.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.9909  -24.4770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.5980  -25.0240    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   52.5768  -23.7646    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   53.3940  -23.7646    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  9 10  2  0
  9 11  1  0
  8  9  1  0
  6 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21  2  1  0
  2 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  CHG  2   9   1  11  -1
M  END

Alternative Forms

  1. Parent:

    ALA5077837

    ---

Associated Targets(non-human)

Slc14a1 Urea transporter 1 (102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc14a1 Urea transporter 1 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.37Molecular Weight (Monoisotopic): 455.0399AlogP: 4.26#Rotatable Bonds: 6
Polar Surface Area: 131.55Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.89CX Basic pKa: CX LogP: 3.52CX LogD: 3.41
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -2.01

References

1. Wang S, Xu Y, Zhao Y, Zhang S, Li M, Li X, He J, Zhou H, Ge Z, Li R, Yang B..  (2021)  N-(4-acetamidophenyl)-5-acetylfuran-2-carboxamide as a novel orally available diuretic that targets urea transporters with improved PD and PK properties.,  226  [PMID:34601246] [10.1016/j.ejmech.2021.113859]

Source