The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isobutyl N-(5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl)sulfamoylcarbamate ID: ALA5077863
PubChem CID: 9933617
Max Phase: Preclinical
Molecular Formula: C20H21F2N3O5S
Molecular Weight: 453.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc3cc(F)c(F)cc3[nH]2)cc1NS(=O)(=O)NC(=O)OCC(C)C
Standard InChI: InChI=1S/C20H21F2N3O5S/c1-11(2)10-30-20(26)25-31(27,28)24-18-7-12(4-5-19(18)29-3)16-8-13-6-14(21)15(22)9-17(13)23-16/h4-9,11,23-24H,10H2,1-3H3,(H,25,26)
Standard InChI Key: TZVQBYGXSQTCLW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-4.4984 2.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7838 2.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0720 2.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0720 1.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7820 0.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4984 1.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2872 1.0631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2872 2.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8022 1.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9770 1.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5642 2.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2584 2.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6712 1.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2619 1.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5626 1.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2131 2.5555 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.2131 0.9017 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4963 1.7295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9089 2.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6746 0.3030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4997 0.3030 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9123 -0.4115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7375 -0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1501 -1.1262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1501 0.3030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9753 -1.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3879 -1.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2131 -1.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9753 -2.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2157 0.7164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4997 1.1282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
3 8 1 0
8 9 2 0
9 7 1 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
10 15 1 0
15 14 2 0
1 16 1 0
6 17 1 0
13 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
21 30 2 0
21 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.47Molecular Weight (Monoisotopic): 453.1170AlogP: 4.16#Rotatable Bonds: 7Polar Surface Area: 109.52Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.74CX Basic pKa: ┄CX LogP: 3.54CX LogD: 2.59Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.07
References 1. Golovanov A, Zhuravlev A, Cruz A, Aksenov V, Shafiullina R, Kakularam KR, Lluch JM, Kuhn H, González-Lafont À, Ivanov I.. (2022) N -Substituted 5-(1H -Indol-2-yl)-2-methoxyanilines Are Allosteric Inhibitors of the Linoleate Oxygenase Activity of Selected Mammalian ALOX15 Orthologs: Mechanism of Action., 65 (3.0): [PMID:35073698 ] [10.1021/acs.jmedchem.1c01563 ]