(E)-4-[[2-(Phenylcarbamothioyl)hydrazono]methyl]phenyl1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulfonate

ID: ALA5078014

PubChem CID: 166630146

Max Phase: Preclinical

Molecular Formula: C18H12F9N3O3S2

Molecular Weight: 553.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(Oc1ccc(/C=N/NC(=S)Nc2ccccc2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F

Standard InChI:  InChI=1S/C18H12F9N3O3S2/c19-15(20,17(23,24)25)16(21,22)18(26,27)35(31,32)33-13-8-6-11(7-9-13)10-28-30-14(34)29-12-4-2-1-3-5-12/h1-10H,(H2,29,30,34)/b28-10+

Standard InChI Key:  QDVLLHUIQMWNOW-ORBVJSQLSA-N

Molfile:  

 
     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   36.9181   -2.3443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.5136   -1.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1046   -2.3417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.3910   -0.5242    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.8037   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2121   -0.5217    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.0868   -2.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6823   -1.6509    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.2733   -2.3540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5024   -2.3484    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.0980   -1.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6890   -2.3458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.9753   -0.5283    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.3881   -1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7965   -0.5258    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.6151   -4.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6139   -4.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3261   -5.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0358   -4.9421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0329   -4.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3243   -3.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3219   -2.8970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0284   -2.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0259   -1.6691    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.7373   -2.8928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4438   -2.4821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1527   -2.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8592   -2.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5664   -2.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2724   -2.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2704   -1.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5565   -1.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8534   -1.6644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9763   -1.2467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2267   -1.2284    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  8  7  2  0
  9  8  2  0
 11 10  1  0
 12 11  1  0
 14 13  1  0
 15 14  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 34  8  1  0
  8 14  1  0
 14 11  1  0
 11  5  1  0
  5  2  1  0
  2 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5078014

    ---

Associated Targets(Human)

UACC-257 (46019 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
UO-31 (46270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 553.43Molecular Weight (Monoisotopic): 553.0176AlogP: 5.14#Rotatable Bonds: 8
Polar Surface Area: 79.79Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.41CX Basic pKa: 1.13CX LogP: 6.60CX LogD: 6.60
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.16Np Likeness Score: -1.28

References

1. Tantawy AH, El-Behairy MF, Abd-Allah WH, Jiang H, Wang MQ, Marzouk AA..  (2021)  Design, Synthesis, Biological Evaluation, and Computational Studies of Novel Fluorinated Candidates as PI3K Inhibitors: Targeting Fluorophilic Binding Sites.,  64  (23.0): [PMID:34791873] [10.1021/acs.jmedchem.1c01674]

Source