Ethyl 5-(3-(3-fluorobenzyl)ureido)-1-(2-hydroxypentyl)-1H-pyrazole-4-carboxylate

ID: ALA5078432

PubChem CID: 155814279

Max Phase: Preclinical

Molecular Formula: C19H25FN4O4

Molecular Weight: 392.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC(O)Cn1ncc(C(=O)OCC)c1NC(=O)NCc1cccc(F)c1

Standard InChI:  InChI=1S/C19H25FN4O4/c1-3-6-15(25)12-24-17(16(11-22-24)18(26)28-4-2)23-19(27)21-10-13-7-5-8-14(20)9-13/h5,7-9,11,15,25H,3-4,6,10,12H2,1-2H3,(H2,21,23,27)

Standard InChI Key:  OCWVEAWKWOGPNU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 29  0  0  0  0  0  0  0  0999 V2000
   36.1696  -14.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1685  -14.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8765  -15.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5862  -14.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5833  -14.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8747  -13.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2895  -13.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9988  -14.1392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7049  -13.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4142  -14.1338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.7018  -12.9107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4080  -12.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1524  -12.8299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.6970  -12.2205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2857  -11.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4870  -11.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8766  -11.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0418  -10.3437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4314   -9.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5966   -9.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1009  -11.4011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.3243  -13.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1021  -13.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2740  -14.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7081  -13.3311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4618  -13.7397    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.6681  -15.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8400  -16.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 17 21  2  0
 13 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
  1 26  1  0
 24 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5078432

    ---

Associated Targets(Human)

HL-60(TB) (4309 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H522 (44358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.43Molecular Weight (Monoisotopic): 392.1860AlogP: 2.68#Rotatable Bonds: 9
Polar Surface Area: 105.48Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.11CX Basic pKa: 0.73CX LogP: 3.19CX LogD: 3.19
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: -1.60

References

1. Morretta E, Sidibè A, Spallarossa A, Petrella A, Meta E, Bruno O, Monti MC, Brullo C..  (2021)  Synthesis, functional proteomics and biological evaluation of new 5-pyrazolyl ureas as potential anti-angiogenic compounds.,  226  [PMID:34600191] [10.1016/j.ejmech.2021.113872]

Source