The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-((S)-3-(2-chloroacetamido)-4-oxo-4-(propylamino)butanamido)tetrahydro-2H-pyran-3,4-diyldiacetate ID: ALA5078830
PubChem CID: 151597392
Max Phase: Preclinical
Molecular Formula: C23H35ClN4O11
Molecular Weight: 579.00
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)[C@H](CC(=O)N[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O)NC(=O)CCl
Standard InChI: InChI=1S/C23H35ClN4O11/c1-6-7-25-22(35)15(27-18(34)9-24)8-17(33)28-23-19(26-11(2)29)21(38-14(5)32)20(37-13(4)31)16(39-23)10-36-12(3)30/h15-16,19-21,23H,6-10H2,1-5H3,(H,25,35)(H,26,29)(H,27,34)(H,28,33)/t15-,16+,19+,20+,21+,23+/m0/s1
Standard InChI Key: QJTFDUPWBXXTBO-YXSTWSFQSA-N
Molfile:
RDKit 2D
39 39 0 0 0 0 0 0 0 0999 V2000
0.3602 0.0021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3537 -0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 0.0021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7860 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7860 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3537 -1.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3602 -1.6513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 -2.4781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 -1.6514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 -0.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9289 0.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6439 -0.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9289 0.8289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3577 -2.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3577 -3.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3568 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4988 -2.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2128 -2.8899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7844 -2.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0752 -1.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7891 -1.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0752 -0.4147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3591 0.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0731 1.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 1.2397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7859 2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3575 2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7849 3.3041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5004 2.0666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2149 2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9294 2.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6439 2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3575 3.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3569 3.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 3.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0714 3.3032 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
2 7 1 0
7 6 1 0
7 8 1 6
6 9 1 1
5 10 1 6
4 11 1 1
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
9 16 1 0
16 17 2 0
16 18 1 0
10 19 1 0
19 20 2 0
19 21 1 0
8 22 1 0
22 23 1 0
22 24 2 0
1 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
28 30 1 6
29 31 2 0
29 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
30 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.00Molecular Weight (Monoisotopic): 578.1991AlogP: -1.60#Rotatable Bonds: 13Polar Surface Area: 204.53Molecular Species: NEUTRALHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.94CX Basic pKa: ┄CX LogP: -2.53CX LogD: -2.53Aromatic Rings: ┄Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: 0.46
References 1. (2021) Inhibition of ngly1 for the treatment of cancer,