(S)-N-(7-hydroxy-2-((4aS,5aR)-5a-methyl-1,4,4a,5,5a,6-hexahydrocyclopropa[f]indazol-3-yl)-1H-benzo[d]imidazol-5-yl)-N-methyl-2-morpholinopropanamide

ID: ALA5079033

PubChem CID: 156494987

Max Phase: Preclinical

Molecular Formula: C24H30N6O3

Molecular Weight: 450.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](C(=O)N(C)c1cc(O)c2[nH]c(-c3n[nH]c4c3C[C@@H]3C[C@]3(C)C4)nc2c1)N1CCOCC1

Standard InChI:  InChI=1S/C24H30N6O3/c1-13(30-4-6-33-7-5-30)23(32)29(3)15-9-17-21(19(31)10-15)26-22(25-17)20-16-8-14-11-24(14,2)12-18(16)27-28-20/h9-10,13-14,31H,4-8,11-12H2,1-3H3,(H,25,26)(H,27,28)/t13-,14+,24+/m0/s1

Standard InChI Key:  JQIBOKWDFMIEJM-NYOFJVTHSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   14.8517  -15.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8517  -15.9807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5652  -16.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2786  -15.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2786  -15.1547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5652  -14.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9958  -14.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7105  -15.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4275  -14.7459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7080  -15.9849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1423  -15.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4300  -13.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1385  -15.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8523  -16.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8558  -14.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5661  -15.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5673  -15.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3543  -16.2439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8412  -15.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3524  -14.9044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6669  -15.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9393  -15.1545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1530  -14.8977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9405  -15.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1563  -16.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9822  -17.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5504  -16.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3774  -17.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5982  -17.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2097  -18.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1825  -18.3011    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.0877  -17.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9894  -13.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8518  -17.2249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
  9 12  1  0
 11 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 11  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 21 25  1  0
 24 22  1  0
 22 23  1  0
 23 21  2  0
 19 21  1  0
 24 25  2  0
 24 27  1  0
 25 26  1  0
 26 29  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 28 30  1  0
 29 31  1  6
 28 32  1  6
  7 33  1  1
 14 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5079033

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NTRK1 Tclin Nerve growth factor receptor Trk-A (7922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.2379AlogP: 2.47#Rotatable Bonds: 4
Polar Surface Area: 110.37Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.29CX Basic pKa: 5.44CX LogP: 2.20CX LogD: 2.14
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -0.70

References

1. Abdel-Magid AF..  (2021)  Dual Inhibition of IL-2-Inducible T-Cell Kinase (ITK) and Tropomyosin Receptor Kinase A (TRKA) as Potential Treatment for Atopic Dermatitis and Other Inflammatory and Autoimmune Diseases.,  12  (12.0): [PMID:34917248] [10.1021/acsmedchemlett.1c00619]

Source