The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5079094
PubChem CID: 164710695
Max Phase: Preclinical
Molecular Formula: C31H39N3O7
Molecular Weight: 565.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1C[C@@]23CC[C@@H](C)[C@@](C)([C@H](OC(C)=O)C[C@@H](C4=CCn5c(=O)n(-c6ccccc6)c(=O)n5C4)[C@@H]2C)[C@]3(O)C1=O
Standard InChI: InChI=1S/C31H39N3O7/c1-18-11-13-30-16-24(40-5)26(36)31(30,39)29(18,4)25(41-20(3)35)15-23(19(30)2)21-12-14-32-27(37)34(28(38)33(32)17-21)22-9-7-6-8-10-22/h6-10,12,18-19,23-25,39H,11,13-17H2,1-5H3/t18-,19+,23-,24+,25-,29+,30+,31-/m1/s1
Standard InChI Key: HHIJMNKZMQVUFD-GHRISSMUSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
-0.6938 -1.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8860 -2.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3784 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4456 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 -2.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7888 -1.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0490 -1.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7906 -3.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0158 -3.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9544 -3.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8836 -3.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7267 -2.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6753 -3.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0490 -0.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3684 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0977 -2.1481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2531 -3.9521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6721 -4.3669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3666 -0.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6753 -2.4492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2531 -1.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0425 -2.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0416 -1.0821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6585 0.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6585 0.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0491 1.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7568 0.9530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7568 0.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3640 1.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2190 2.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0317 2.2462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4402 2.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0318 3.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4398 4.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2573 4.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6652 3.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2610 2.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 2.7386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1533 1.2882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1677 -3.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0425 -3.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
7 6 1 0
1 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
5 10 1 1
4 11 1 0
5 12 1 0
12 13 1 0
13 11 1 0
7 14 1 1
8 15 1 1
4 16 1 6
13 17 1 6
11 18 2 0
6 19 1 6
2 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
24 14 2 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
14 28 1 0
27 29 1 0
26 30 1 0
30 31 1 0
31 29 1 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
32 37 1 0
37 36 2 0
30 38 2 0
29 39 2 0
3 40 1 6
17 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.67Molecular Weight (Monoisotopic): 565.2788AlogP: 2.47#Rotatable Bonds: 4Polar Surface Area: 121.76Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.24CX Basic pKa: ┄CX LogP: 3.17CX LogD: 3.17Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.45Np Likeness Score: 1.55
References 1. (2020) Compounds that induce ferroptic cell death,