The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(5-(8-cyclopropyl-2-methyl-9H-pyrido[2,3-b]indol-3-yl)-1,3,4-oxadiazol-2-yl)-2-methylpropyl)-3-phenylpropanamide ID: ALA5079107
PubChem CID: 166627668
Max Phase: Preclinical
Molecular Formula: C30H31N5O2
Molecular Weight: 493.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2[nH]c3c(C4CC4)cccc3c2cc1-c1nnc(C(NC(=O)CCc2ccccc2)C(C)C)o1
Standard InChI: InChI=1S/C30H31N5O2/c1-17(2)26(32-25(36)15-12-19-8-5-4-6-9-19)30-35-34-29(37-30)23-16-24-22-11-7-10-21(20-13-14-20)27(22)33-28(24)31-18(23)3/h4-11,16-17,20,26H,12-15H2,1-3H3,(H,31,33)(H,32,36)
Standard InChI Key: YZHKJZDQIGUOAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
20.4339 -2.1544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0968 -2.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8407 -3.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3825 -4.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1807 -3.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4341 -3.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8905 -2.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0253 -3.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7755 -2.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9804 -2.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4343 -3.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6888 -3.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4833 -4.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2334 -2.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7263 -1.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8973 -0.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1198 -1.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7241 -4.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5585 -5.2487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2624 -5.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8675 -5.1127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5375 -4.3693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3468 -6.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0929 -6.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6851 -6.9485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1774 -7.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7546 -6.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9390 -6.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2773 -7.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8545 -5.8024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5311 -6.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8694 -7.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1255 -6.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4642 -7.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5483 -8.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2994 -8.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9575 -8.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 3 1 0
2 1 1 0
1 9 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 14 1 0
16 15 1 0
17 16 1 0
15 17 1 0
10 15 1 0
5 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 2 0
20 23 1 0
23 24 1 0
23 25 1 0
24 26 1 0
24 27 1 0
25 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.61Molecular Weight (Monoisotopic): 493.2478AlogP: 6.40#Rotatable Bonds: 8Polar Surface Area: 96.70Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.51CX Basic pKa: 1.55CX LogP: 4.91CX LogD: 4.91Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.72
References 1. Bessho Y, Akaki T, Hara Y, Yamakawa M, Obika S, Mori G, Ubukata M, Yasue K, Nakane Y, Terasako Y, Orita T, Doi S, Iwanaga T, Fujishima A, Adachi T, Ueno H, Motomura T.. (2021) Structure-based drug design of novel and highly potent pyruvate dehydrogenase kinase inhibitors., 52 [PMID:34808405 ] [10.1016/j.bmc.2021.116514 ]