The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,5'-ethane-1,2-diylbis(oxy)bis(benzene-1,2,4-trisphosphate) ID: ALA5080660
PubChem CID: 155294439
Max Phase: Preclinical
Molecular Formula: C14H20O26P6
Molecular Weight: 790.13
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)Oc1cc(OP(=O)(O)O)c(OP(=O)(O)O)cc1OCCOc1cc(OP(=O)(O)O)c(OP(=O)(O)O)cc1OP(=O)(O)O
Standard InChI: InChI=1S/C14H20O26P6/c15-41(16,17)35-9-5-13(39-45(27,28)29)11(37-43(21,22)23)3-7(9)33-1-2-34-8-4-12(38-44(24,25)26)14(40-46(30,31)32)6-10(8)36-42(18,19)20/h3-6H,1-2H2,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)(H2,30,31,32)
Standard InChI Key: SPZGMBGXCYAMCB-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 47 0 0 0 0 0 0 0 0999 V2000
2.4928 -19.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9056 -19.8602 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.3140 -19.1479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5570 -19.7447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1525 -19.0389 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.7435 -19.7421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1413 -22.2004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7368 -21.4946 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.3279 -22.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0325 -18.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3231 -19.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3225 -19.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0307 -20.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7408 -19.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7379 -19.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4446 -18.6346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0315 -21.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8600 -18.6311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4470 -21.0886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6145 -20.2714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1991 -20.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9085 -14.2472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3212 -14.9571 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.7296 -14.2447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7356 -11.7915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1484 -12.5014 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.5568 -11.7890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9726 -14.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5681 -14.1275 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.1592 -14.8307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7396 -14.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7384 -14.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4465 -15.3683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1561 -14.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1533 -14.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4447 -13.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8595 -13.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2749 -13.7197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0304 -15.3674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6150 -15.3663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4422 -12.9138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8576 -12.9096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4463 -16.1855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7384 -16.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7382 -17.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0304 -17.8196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
8 7 1 0
9 8 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
13 17 1 0
16 5 1 0
17 8 1 0
5 18 2 0
8 19 2 0
12 20 1 0
20 2 1 0
2 21 2 0
23 22 1 0
24 23 1 0
26 25 1 0
27 26 1 0
29 28 1 0
30 29 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
35 37 1 0
37 29 1 0
29 38 2 0
32 39 1 0
39 23 1 0
23 40 2 0
36 41 1 0
41 26 1 0
26 42 2 0
33 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 10 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 790.13Molecular Weight (Monoisotopic): 789.8669AlogP: -0.03#Rotatable Bonds: 17Polar Surface Area: 419.02Molecular Species: ACIDHBA: 14HBD: 12#RO5 Violations: 3HBA (Lipinski): 26HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.11CX Basic pKa: ┄CX LogP: -2.28CX LogD: -14.91Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.07Np Likeness Score: 0.18
References 1. Whitfield H, Hemmings AM, Mills SJ, Baker K, White G, Rushworth S, Riley AM, Potter BVL, Brearley CA.. (2021) Allosteric Site on SHIP2 Identified Through Fluorescent Ligand Screening and Crystallography: A Potential New Target for Intervention., 64 (7.0): [PMID:33724834 ] [10.1021/acs.jmedchem.0c01944 ]