(R)-N-methyl-N-(6-methyl-2-((4aS,5aR)-5a-methyl-1,4,4a,5,5a,6-hexahydrocyclopropa[f]indazol-3-yl)-1H-benzo[d]imidazol-5-yl)-2-morpholinopropanamide

ID: ALA5080834

PubChem CID: 156494946

Max Phase: Preclinical

Molecular Formula: C25H32N6O2

Molecular Weight: 448.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc2[nH]c(-c3n[nH]c4c3C[C@@H]3C[C@]3(C)C4)nc2cc1N(C)C(=O)[C@@H](C)N1CCOCC1

Standard InChI:  InChI=1S/C25H32N6O2/c1-14-9-18-19(11-21(14)30(4)24(32)15(2)31-5-7-33-8-6-31)27-23(26-18)22-17-10-16-12-25(16,3)13-20(17)28-29-22/h9,11,15-16H,5-8,10,12-13H2,1-4H3,(H,26,27)(H,28,29)/t15-,16-,25-/m1/s1

Standard InChI Key:  DVXKDRBZBOJVGG-WHEFHEQHSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   14.3174   -1.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3174   -2.6497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0268   -3.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7362   -2.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7362   -1.8284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0268   -1.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4492   -1.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1598   -1.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8729   -1.4219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1574   -2.6538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5835   -1.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8753   -0.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5798   -2.6590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2896   -3.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2930   -1.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9992   -1.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0004   -2.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7830   -2.9113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2670   -2.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7810   -1.5794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8663   -3.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0880   -2.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3532   -1.8281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5715   -1.5728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3544   -2.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5748   -2.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4015   -3.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9609   -3.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7888   -3.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0140   -4.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6221   -4.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6007   -4.9568    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.4951   -4.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4429   -0.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
  9 12  1  0
 11 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 11  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 13 21  1  0
 22 26  1  0
 25 23  1  0
 23 24  1  0
 24 22  2  0
 19 22  1  0
 25 26  2  0
 25 28  1  0
 26 27  1  0
 27 30  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 29 31  1  0
 30 32  1  6
 29 33  1  6
  7 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5080834

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NTRK1 Tclin Nerve growth factor receptor Trk-A (7922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.57Molecular Weight (Monoisotopic): 448.2587AlogP: 3.07#Rotatable Bonds: 4
Polar Surface Area: 90.14Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.44CX Basic pKa: 5.51CX LogP: 3.01CX LogD: 3.01
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.64Np Likeness Score: -0.99

References

1. Abdel-Magid AF..  (2021)  Dual Inhibition of IL-2-Inducible T-Cell Kinase (ITK) and Tropomyosin Receptor Kinase A (TRKA) as Potential Treatment for Atopic Dermatitis and Other Inflammatory and Autoimmune Diseases.,  12  (12.0): [PMID:34917248] [10.1021/acsmedchemlett.1c00619]

Source