The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (Z)-2-((Z)-4-oxo-3-phenyl-2-(((E)-4-(trifluoromethyl)-benzylidene)hydrazineylidene)thiazolidin-5-ylidene)acetate ID: ALA5081309
PubChem CID: 166630016
Max Phase: Preclinical
Molecular Formula: C20H14F3N3O3S
Molecular Weight: 433.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C=C1\S/C(=N\N=C\c2ccc(C(F)(F)F)cc2)N(c2ccccc2)C1=O
Standard InChI: InChI=1S/C20H14F3N3O3S/c1-29-17(27)11-16-18(28)26(15-5-3-2-4-6-15)19(30-16)25-24-12-13-7-9-14(10-8-13)20(21,22)23/h2-12H,1H3/b16-11-,24-12+,25-19-
Standard InChI Key: MILMQRXURVRDIG-NUNJCAKTSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
6.9029 -10.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9145 -9.7219 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.6997 -9.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1754 -10.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6828 -10.8049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9234 -11.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7215 -11.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9627 -12.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4068 -13.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6065 -12.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3690 -12.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9925 -10.1574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9607 -8.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4206 -8.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6816 -7.3132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1414 -6.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6194 -8.2488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5106 -10.0415 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9233 -9.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1016 -9.3271 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1996 -10.9472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4894 -10.5431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7801 -10.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0657 -10.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0638 -9.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3502 -9.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6400 -9.7413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6477 -10.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3619 -10.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9188 -8.5127 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
5 6 1 0
12 4 2 0
3 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 2 0
19 18 1 0
20 19 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 19 1 0
19 30 1 0
21 1 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.41Molecular Weight (Monoisotopic): 433.0708AlogP: 4.23#Rotatable Bonds: 4Polar Surface Area: 71.33Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.57CX LogD: 4.57Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -1.42
References 1. Tantawy AH, El-Behairy MF, Abd-Allah WH, Jiang H, Wang MQ, Marzouk AA.. (2021) Design, Synthesis, Biological Evaluation, and Computational Studies of Novel Fluorinated Candidates as PI3K Inhibitors: Targeting Fluorophilic Binding Sites., 64 (23.0): [PMID:34791873 ] [10.1021/acs.jmedchem.1c01674 ]