The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[[7-acetyl-3-(2-furylmethyl)-4-oxo-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide ID: ALA5081350
PubChem CID: 50799610
Max Phase: Preclinical
Molecular Formula: C25H24N4O5S2
Molecular Weight: 524.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1NC(=O)CSc1nc2sc3c(c2c(=O)n1Cc1ccco1)CCN(C(C)=O)C3
Standard InChI: InChI=1S/C25H24N4O5S2/c1-15(30)28-10-9-17-20(13-28)36-23-22(17)24(32)29(12-16-6-5-11-34-16)25(27-23)35-14-21(31)26-18-7-3-4-8-19(18)33-2/h3-8,11H,9-10,12-14H2,1-2H3,(H,26,31)
Standard InChI Key: IPVCZLJVSCHTDM-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-1.3857 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6712 1.2561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0432 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6712 -0.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3857 0.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1703 1.0985 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1703 -0.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6552 0.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5060 -0.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3265 -1.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8115 -0.4087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4758 0.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6367 -0.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0494 -1.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0494 0.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6712 -1.2192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7579 1.2562 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4727 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1874 1.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9022 0.8436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1874 2.0816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7579 -0.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7579 -1.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4253 -1.7077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1704 -2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3455 -2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0906 -1.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0432 0.0185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6169 1.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6171 2.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3301 2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0450 2.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0466 1.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3347 0.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3347 0.0165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0494 -0.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
1 5 2 0
5 4 1 0
1 6 1 0
5 7 1 0
7 8 2 0
8 6 1 0
7 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
8 12 1 0
11 13 1 0
13 14 1 0
13 15 2 0
4 16 2 0
3 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
22 23 1 0
24 23 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 23 2 0
28 22 1 0
4 28 1 0
3 28 1 0
20 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.62Molecular Weight (Monoisotopic): 524.1188AlogP: 3.74#Rotatable Bonds: 7Polar Surface Area: 106.67Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.14CX Basic pKa: 2.14CX LogP: 2.89CX LogD: 2.89Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -2.55
References 1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S.. (2022) CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation., 65 (7.0): [PMID:35348328 ] [10.1021/acs.jmedchem.1c02168 ]