2-[[7-acetyl-3-(2-furylmethyl)-4-oxo-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide

ID: ALA5081350

PubChem CID: 50799610

Max Phase: Preclinical

Molecular Formula: C25H24N4O5S2

Molecular Weight: 524.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1NC(=O)CSc1nc2sc3c(c2c(=O)n1Cc1ccco1)CCN(C(C)=O)C3

Standard InChI:  InChI=1S/C25H24N4O5S2/c1-15(30)28-10-9-17-20(13-28)36-23-22(17)24(32)29(12-16-6-5-11-34-16)25(27-23)35-14-21(31)26-18-7-3-4-8-19(18)33-2/h3-8,11H,9-10,12-14H2,1-2H3,(H,26,31)

Standard InChI Key:  IPVCZLJVSCHTDM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -1.3857    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6712    1.2561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0432    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6712   -0.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3857    0.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1703    1.0985    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1703   -0.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6552    0.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5060   -0.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3265   -1.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8115   -0.4087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4758    0.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6367   -0.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0494   -1.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0494    0.3060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6712   -1.2192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7579    1.2562    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4727    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1874    1.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9022    0.8436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1874    2.0816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7579   -0.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7579   -1.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4253   -1.7077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1704   -2.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3455   -2.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0906   -1.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0432    0.0185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6169    1.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6171    2.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3301    2.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0450    2.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0466    1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3347    0.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3347    0.0165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0494   -0.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  1  5  2  0
  5  4  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  6  1  0
  7  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
  8 12  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
  4 16  2  0
  3 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 28 22  1  0
  4 28  1  0
  3 28  1  0
 20 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Associated Targets(Human)

BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.62Molecular Weight (Monoisotopic): 524.1188AlogP: 3.74#Rotatable Bonds: 7
Polar Surface Area: 106.67Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.14CX Basic pKa: 2.14CX LogP: 2.89CX LogD: 2.89
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -2.55

References

1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S..  (2022)  CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation.,  65  (7.0): [PMID:35348328] [10.1021/acs.jmedchem.1c02168]

Source