The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[[7-acetyl-3-(2-furylmethyl)-4-oxo-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N-(p-tolyl)acetamide ID: ALA5081830
Cas Number: 1215481-48-3
PubChem CID: 50799976
Max Phase: Preclinical
Molecular Formula: C25H24N4O4S2
Molecular Weight: 508.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCc2c(sc3nc(SCC(=O)Nc4ccc(C)cc4)n(Cc4ccco4)c(=O)c23)C1
Standard InChI: InChI=1S/C25H24N4O4S2/c1-15-5-7-17(8-6-15)26-21(31)14-34-25-27-23-22(24(32)29(25)12-18-4-3-11-33-18)19-9-10-28(16(2)30)13-20(19)35-23/h3-8,11H,9-10,12-14H2,1-2H3,(H,26,31)
Standard InChI Key: WFJMRRSUYQEYBB-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-1.7408 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0264 1.2561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3118 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0264 -0.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7408 0.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5254 1.0985 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.5254 -0.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0104 0.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8611 -0.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6817 -1.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1666 -0.4087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8310 0.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9919 -0.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4046 -1.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4046 0.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0264 -1.2192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4028 1.2562 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.1175 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8323 1.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5470 0.8436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8323 2.0816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4028 -0.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4028 -1.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0702 -1.7077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8153 -2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0096 -2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2645 -1.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3118 0.0185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2617 1.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2620 2.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9749 2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6899 2.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6914 1.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9795 0.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4046 2.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
1 5 2 0
5 4 1 0
1 6 1 0
5 7 1 0
7 8 2 0
8 6 1 0
7 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
8 12 1 0
11 13 1 0
13 14 1 0
13 15 2 0
4 16 2 0
3 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
22 23 1 0
24 23 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 23 2 0
28 22 1 0
4 28 1 0
3 28 1 0
20 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.63Molecular Weight (Monoisotopic): 508.1239AlogP: 4.04#Rotatable Bonds: 6Polar Surface Area: 97.44Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.92CX Basic pKa: 2.18CX LogP: 3.56CX LogD: 3.56Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -2.67
References 1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S.. (2022) CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation., 65 (7.0): [PMID:35348328 ] [10.1021/acs.jmedchem.1c02168 ]