4-(4-(furan-2-carbonyl)piperazin-1-yl)-1-(3'-methoxybiphenyl-4-yl)pyrrolidin-2-one

ID: ALA5082041

PubChem CID: 166629549

Max Phase: Preclinical

Molecular Formula: C26H27N3O4

Molecular Weight: 445.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2ccc(N3CC(N4CCN(C(=O)c5ccco5)CC4)CC3=O)cc2)c1

Standard InChI:  InChI=1S/C26H27N3O4/c1-32-23-5-2-4-20(16-23)19-7-9-21(10-8-19)29-18-22(17-25(29)30)27-11-13-28(14-12-27)26(31)24-6-3-15-33-24/h2-10,15-16,22H,11-14,17-18H2,1H3

Standard InChI Key:  GYXJKRDYCPURGO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   14.8318   -3.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8307   -4.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5387   -4.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2484   -4.3272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2456   -3.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5370   -3.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9517   -3.0932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6991   -3.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2437   -2.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8324   -2.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0337   -2.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4241   -1.7335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0567   -2.8933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3892   -3.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1984   -3.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6799   -3.0639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3461   -2.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5309   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4926   -3.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8250   -3.8959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9730   -2.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7860   -2.4842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0385   -1.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3774   -1.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7164   -1.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1246   -4.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4169   -4.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7093   -4.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7083   -5.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4206   -5.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1252   -5.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4229   -6.7767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7163   -7.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  2  0
  9 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  2 26  1  0
 30 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5082041

    ---

Associated Targets(non-human)

Mgll Monoglyceride lipase (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 445.52Molecular Weight (Monoisotopic): 445.2002AlogP: 3.52#Rotatable Bonds: 5
Polar Surface Area: 66.23Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.61CX LogP: 2.57CX LogD: 2.56
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.60Np Likeness Score: -1.32

References

1. He Y, Schild M, Grether U, Benz J, Leibrock L, Heer D, Topp A, Collin L, Kuhn B, Wittwer M, Keller C, Gobbi LC, Schibli R, Mu L..  (2022)  Development of High Brain-Penetrant and Reversible Monoacylglycerol Lipase PET Tracers for Neuroimaging.,  65  (3.0): [PMID:35089028] [10.1021/acs.jmedchem.1c01706]

Source