The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tert-butyl 4-(((2-((3-hydroxy-4-methoxybenzyl)(3,4,5-trimethoxyphenyl)amino)-2-oxoethyl)thio)carbonothioyl)piperazine-1-carboxylate ID: ALA5082404
PubChem CID: 163322219
Max Phase: Preclinical
Molecular Formula: C29H39N3O8S2
Molecular Weight: 621.78
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN(C(=O)CSC(=S)N2CCN(C(=O)OC(C)(C)C)CC2)c2cc(OC)c(OC)c(OC)c2)cc1O
Standard InChI: InChI=1S/C29H39N3O8S2/c1-29(2,3)40-27(35)30-10-12-31(13-11-30)28(41)42-18-25(34)32(17-19-8-9-22(36-4)21(33)14-19)20-15-23(37-5)26(39-7)24(16-20)38-6/h8-9,14-16,33H,10-13,17-18H2,1-7H3
Standard InChI Key: GDBUMYUJEKZWFH-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
3.1581 1.7833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1397 0.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4197 0.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7461 0.9897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7645 1.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4560 2.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0261 0.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0083 -0.1888 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 1.0215 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.3674 0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0695 1.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0510 1.8775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7610 0.6697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7827 -0.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0737 -0.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0809 -1.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7869 -1.7648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4957 -1.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4741 -0.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1873 -1.7257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 -1.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7940 -2.5552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5000 -2.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3964 -1.7649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4180 -2.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4454 1.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1369 0.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8458 1.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5519 0.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5735 -0.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8646 -0.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1585 -0.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2650 -0.4886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.9494 -0.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2363 1.1165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8497 2.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8675 2.9625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5517 1.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2433 2.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9420 1.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2433 2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9494 2.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
18 20 1 0
20 21 1 0
17 22 1 0
22 23 1 0
16 24 1 0
24 25 1 0
13 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
30 33 1 0
33 34 1 0
29 35 1 0
1 36 1 0
36 37 2 0
36 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 621.78Molecular Weight (Monoisotopic): 621.2179AlogP: 4.53#Rotatable Bonds: 9Polar Surface Area: 110.24Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.85CX Basic pKa: ┄CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.40Np Likeness Score: -0.94
References 1. Sun YX, Song J, Kong LJ, Sha BB, Tian XY, Liu XJ, Hu T, Chen P, Zhang SY.. (2022) Design, synthesis and evaluation of novel bis-substituted aromatic amide dithiocarbamate derivatives as colchicine site tubulin polymerization inhibitors with potent anticancer activities., 229 [PMID:34971875 ] [10.1016/j.ejmech.2021.114069 ]