kalmitoxin-III

ID: ALA508263

PubChem CID: 44559352

Max Phase: Preclinical

Molecular Formula: C22H36O8

Molecular Weight: 428.52

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Synonyms: Kalmitoxin III | Kalmitoxin III|CHEMBL508263|NS00093901

Canonical SMILES:  CC(=O)O[C@@H]1[C@@H](O)[C@]23C[C@@](C)(O)[C@H](CC[C@H]2[C@@](C)(O)[C@@H]2C[C@H](O)C(C)(C)[C@@]12O)[C@H]3O

Standard InChI:  InChI=1S/C22H36O8/c1-10(23)30-17-16(26)21-9-19(4,27)11(15(21)25)6-7-12(21)20(5,28)13-8-14(24)18(2,3)22(13,17)29/h11-17,24-29H,6-9H2,1-5H3/t11-,12+,13+,14+,15-,16-,17-,19-,20-,21-,22+/m1/s1

Standard InChI Key:  KXLBNQTUONJRNV-PMXXCYMTSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -1.2058    1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6327   -0.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8053   -0.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1431    0.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9488    1.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9712    0.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4623    1.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2846    0.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4922   -0.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0997    0.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9262    1.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1432    1.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0725   -0.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3118   -0.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1064   -0.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7998    2.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7695   -0.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9773   -0.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9533    1.8757    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4623    1.8499    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8169    0.9396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2875    0.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6509    1.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0054   -1.1640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3903   -1.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1030    1.1516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5383   -1.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9096   -2.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7000   -1.8071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7005   -0.8233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3061   -1.1005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6249    2.1134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5603   -0.4655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  1  1
 10 14  1  0
 13 14  1  0
 14 15  1  1
  1 16  1  1
  6 17  1  0
  6 18  1  0
  5 19  1  6
  7 20  1  1
 10 21  1  6
 23 22  1  0
  2 24  1  1
  3 25  1  6
  5  1  1  0
 22 26  1  1
  1  7  1  0
 24 27  1  0
  4  2  1  0
 27 28  1  0
  8  3  1  0
 27 29  2  0
  2  3  1  0
  4  5  1  0
  5 23  1  0
 22  6  1  0
 14 31  1  0
  9 30  1  1
  1 32  1  0
  4 33  1  1
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Lymantria dispar (12 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.52Molecular Weight (Monoisotopic): 428.2410AlogP: -0.29#Rotatable Bonds: 1
Polar Surface Area: 147.68Molecular Species: NEUTRALHBA: 8HBD: 6
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.88CX Basic pKa: CX LogP: -1.69CX LogD: -1.69
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: 3.00

References

1. El-Naggar SF, Doskotch RW, ODell TM, Girard L.  (1980)  Antifeedant Diterpenes For the Gypsy Moth Larvae From Kalmia latifolia: Isolation and Characterization of Ten Grayanoids,  43  (5): [10.1021/np50011a016]

Source