ethyl-3-(2-(benzo[d]oxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxamido)benzoate

ID: ALA5082955

PubChem CID: 166629602

Max Phase: Preclinical

Molecular Formula: C28H24ClN5O4

Molecular Weight: 529.98

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(NC(=O)C2=C(C)NC(Nc3nc4ccccc4o3)=NC2c2ccccc2Cl)cc1

Standard InChI:  InChI=1S/C28H24ClN5O4/c1-3-37-26(36)17-12-14-18(15-13-17)31-25(35)23-16(2)30-27(33-24(23)19-8-4-5-9-20(19)29)34-28-32-21-10-6-7-11-22(21)38-28/h4-15,24H,3H2,1-2H3,(H,31,35)(H2,30,32,33,34)

Standard InChI Key:  IRXNSBSFWSKZAW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   10.7302   -5.3016    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.7437   -4.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7437   -3.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7571   -2.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7666   -3.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7666   -4.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -5.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -6.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7731   -7.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7866   -6.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8000   -7.0506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8135   -6.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8314   -7.0531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8408   -6.4624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8408   -5.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8249   -4.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8135   -5.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8543   -4.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8543   -3.5426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8678   -5.2980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8813   -4.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8948   -5.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7866   -5.2952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7731   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7865   -8.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7596   -8.8059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7460   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7326   -8.8060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7191   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5969   -7.0576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4527   -6.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8650   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6961   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1164   -6.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7017   -7.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8678   -7.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6506   -8.6966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7460   -7.0506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  2  7  2  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 16 15  2  0
 16 17  1  0
 17 12  2  0
 15 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 10 23  2  0
 24  9  2  0
 24 25  1  0
 26 24  1  0
 27 26  1  0
 27 28  1  0
 28 29  1  0
 30 29  2  0
 31 30  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 36 35  1  0
 36 31  2  0
 37 36  1  0
 37 29  1  0
 38 27  2  0
 38  8  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5082955

    ---

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.98Molecular Weight (Monoisotopic): 529.1517AlogP: 5.68#Rotatable Bonds: 6
Polar Surface Area: 117.85Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.61CX Basic pKa: 3.73CX LogP: 5.30CX LogD: 5.30
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.09

References

1.  (2021)  Galactokinase inhibitors, 

Source