N-(((3r,5r,7r)-Adamantan-1-yl)methyl)-6-(4-(3,4-dimethyl-7-oxo-2-(p-tolyl)-2,7-dihydro-6H-pyrazolo[3,4-d]pyridazin-6-yl)butanamido)hexanamide

ID: ALA5083136

PubChem CID: 166630049

Max Phase: Preclinical

Molecular Formula: C35H48N6O3

Molecular Weight: 600.81

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-n2nc3c(=O)n(CCCC(=O)NCCCCCC(=O)NCC45CC6CC(CC(C6)C4)C5)nc(C)c3c2C)cc1

Standard InChI:  InChI=1S/C35H48N6O3/c1-23-10-12-29(13-11-23)41-25(3)32-24(2)38-40(34(44)33(32)39-41)15-7-9-30(42)36-14-6-4-5-8-31(43)37-22-35-19-26-16-27(20-35)18-28(17-26)21-35/h10-13,26-28H,4-9,14-22H2,1-3H3,(H,36,42)(H,37,43)

Standard InChI Key:  XUBGIOYTMWLCEM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
   41.8705   -4.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1166   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4714   -3.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8612   -3.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2708   -3.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4307   -2.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0772   -3.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2590   -2.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7452   -2.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0575   -2.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9188   -6.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3293   -7.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3293   -6.3023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6241   -5.8896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2099   -5.8958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0365   -7.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6241   -7.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9166   -7.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3170   -7.6724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6539   -8.4124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4617   -8.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2537   -9.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4354   -9.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0329   -9.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4475  -10.5420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2689  -10.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6677   -9.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0458  -11.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6241   -5.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3318   -4.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3318   -3.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0395   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0395   -2.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7472   -3.8466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4549   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1626   -3.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8703   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5780   -3.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2857   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9934   -3.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7011   -3.4380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4088   -3.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9934   -4.6638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0136   -8.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 18  1  0
 11 14  1  0
 17 12  1  0
 12 13  2  0
 13 14  1  0
 11 15  2  0
 12 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 17  2  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 20 22  1  0
 25 28  1  0
 14 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42  2  1  0
 40 43  2  0
 21 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5083136

    ---

Associated Targets(Human)

PDE6D Tclin Phosphodiesterase 6D (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 600.81Molecular Weight (Monoisotopic): 600.3788AlogP: 5.30#Rotatable Bonds: 13
Polar Surface Area: 110.91Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.40CX LogD: 4.40
Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.26Np Likeness Score: -1.23

References

1. Guo M, He S, Cheng J, Li Y, Dong G, Sheng C..  (2022)  Hydrophobic Tagging-Induced Degradation of PDEδ in Colon Cancer Cells.,  13  (2.0): [PMID:35178186] [10.1021/acsmedchemlett.1c00670]

Source