(R)-N-(7-fluoro-2-((4aS,5aR)-5a-methyl-1,4,4a,5,5a,6-hexahydrocyclopropa[f]indazol-3-yl)-1H-benzo[d]imidazol-5-yl)-N-methyl-2-(3-oxomorpholino)propanamide

ID: ALA5083169

PubChem CID: 156494905

Max Phase: Preclinical

Molecular Formula: C24H27FN6O3

Molecular Weight: 466.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](C(=O)N(C)c1cc(F)c2[nH]c(-c3n[nH]c4c3C[C@@H]3C[C@]3(C)C4)nc2c1)N1CCOCC1=O

Standard InChI:  InChI=1S/C24H27FN6O3/c1-12(31-4-5-34-11-19(31)32)23(33)30(3)14-7-16(25)21-17(8-14)26-22(27-21)20-15-6-13-9-24(13,2)10-18(15)28-29-20/h7-8,12-13H,4-6,9-11H2,1-3H3,(H,26,27)(H,28,29)/t12-,13-,24-/m1/s1

Standard InChI Key:  MWXHTQHHPZLBPI-IPKGXFCISA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   27.9909   -9.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9909  -10.2273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7003  -10.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4097  -10.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4097   -9.4060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7003   -8.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1227   -8.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8333   -9.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5464   -8.9995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8309  -10.2314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2570   -9.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5488   -8.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533  -10.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9631  -10.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9665   -9.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6727   -9.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6740  -10.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4565  -10.4889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9405   -9.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4545   -9.1570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7615   -9.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0267   -9.4057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2450   -9.1504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0280  -10.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2483  -10.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0750  -11.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6344  -10.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4623  -11.5714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6875  -11.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2956  -12.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2742  -12.5344    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.1686  -11.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1164   -8.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7003   -8.1719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9625  -11.4644    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
  9 12  1  0
 11 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 11  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 21 25  1  0
 24 22  1  0
 22 23  1  0
 23 21  2  0
 19 21  1  0
 24 25  2  0
 24 27  1  0
 25 26  1  0
 26 29  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 28 30  1  0
 29 31  1  6
 28 32  1  6
  7 33  1  6
  6 34  2  0
 14 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5083169

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NTRK1 Tclin Nerve growth factor receptor Trk-A (7922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.52Molecular Weight (Monoisotopic): 466.2129AlogP: 2.43#Rotatable Bonds: 4
Polar Surface Area: 107.21Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.57CX Basic pKa: 4.09CX LogP: 1.74CX LogD: 1.72
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -0.75

References

1. Abdel-Magid AF..  (2021)  Dual Inhibition of IL-2-Inducible T-Cell Kinase (ITK) and Tropomyosin Receptor Kinase A (TRKA) as Potential Treatment for Atopic Dermatitis and Other Inflammatory and Autoimmune Diseases.,  12  (12.0): [PMID:34917248] [10.1021/acsmedchemlett.1c00619]

Source