The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyano-4-[(spiro[2.5]oct-6-ylmethyl)-amino]-pyrimidine-5-carboxylic acid (1-methyl-4-phenyl-piperidin-4-ylmethyl)-amide ID: ALA508319
PubChem CID: 44587937
Max Phase: Preclinical
Molecular Formula: C28H36N6O
Molecular Weight: 472.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCC(CNC(=O)c2cnc(C#N)nc2NCC2CCC3(CC2)CC3)(c2ccccc2)CC1
Standard InChI: InChI=1S/C28H36N6O/c1-34-15-13-28(14-16-34,22-5-3-2-4-6-22)20-32-26(35)23-19-30-24(17-29)33-25(23)31-18-21-7-9-27(10-8-21)11-12-27/h2-6,19,21H,7-16,18,20H2,1H3,(H,32,35)(H,30,31,33)
Standard InChI Key: FJKPOCSUBVDARQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
4.4708 -0.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1833 0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4468 0.5978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1753 -4.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7587 -3.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5840 -3.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6138 -2.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3288 -2.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0390 -2.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7519 -2.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0435 -3.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3244 -3.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6127 -1.4585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9019 -0.2235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6157 0.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3308 -0.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6144 1.0151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3277 -1.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0420 -1.4582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7568 -1.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7528 -0.2153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0380 0.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4724 -1.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1892 -1.8670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7400 1.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0316 0.5767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0465 -0.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7698 -0.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4718 -1.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7562 -1.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7568 -2.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4723 -2.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1886 -2.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1845 -1.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3104 0.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
16 18 2 0
18 19 1 0
1 3 1 0
19 20 2 0
8 12 1 0
20 21 1 0
9 10 1 0
21 22 2 0
22 16 1 0
18 13 1 0
10 5 1 0
20 23 1 0
5 11 1 0
23 24 3 0
11 12 1 0
5 4 1 0
7 13 1 0
6 5 1 0
1 28 1 0
3 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
2 14 1 0
1 29 1 0
7 8 1 0
29 30 2 0
14 15 1 0
30 31 1 0
8 9 1 0
31 32 2 0
15 16 1 0
32 33 1 0
4 6 1 0
33 34 2 0
34 29 1 0
15 17 2 0
26 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.64Molecular Weight (Monoisotopic): 472.2951AlogP: 4.12#Rotatable Bonds: 7Polar Surface Area: 93.94Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.18CX Basic pKa: 8.88CX LogP: 4.71CX LogD: 3.22Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.63Np Likeness Score: -0.67
References 1. Irie O, Yokokawa F, Ehara T, Iwasaki A, Iwaki Y, Hitomi Y, Konishi K, Kishida M, Toyao A, Masuya K, Gunji H, Sakaki J, Iwasaki G, Hirao H, Kanazawa T, Tanabe K, Kosaka T, Hart TW, Hallett A.. (2008) 4-Amino-2-cyanopyrimidines: novel scaffold for nonpeptidic cathepsin S inhibitors., 18 (16): [PMID:18662880 ] [10.1016/j.bmcl.2008.07.011 ]