ID: ALA5083529

PubChem CID: 137530048

Max Phase: Preclinical

Molecular Formula: C29H36ClNO7

Molecular Weight: 546.06

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCN1C(=O)C2CC=C([C@@H]3C[C@@H](OC(=O)CCl)[C@]4(C)[C@H](C)CC[C@]5(C[C@H](O)C(=O)[C@]54O)[C@H]3C)CC2C1=O

Standard InChI:  InChI=1S/C29H36ClNO7/c1-5-10-31-25(35)18-7-6-17(11-20(18)26(31)36)19-12-22(38-23(33)14-30)27(4)15(2)8-9-28(16(19)3)13-21(32)24(34)29(27,28)37/h1,6,15-16,18-22,32,37H,7-14H2,2-4H3/t15-,16+,18?,19-,20?,21+,22-,27+,28+,29-/m1/s1

Standard InChI Key:  UQINDGRIYWGWCE-OPZZZPQTSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -0.1933   -1.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3856   -2.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1220   -2.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9461   -2.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4671   -2.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2892   -1.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5495   -1.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2901   -3.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5162   -3.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4548   -3.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3841   -3.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2271   -2.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1758   -3.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5495   -0.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8679   -4.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5981   -2.1492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7536   -3.9533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1726   -4.3680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8671   -0.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1749   -2.4504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7527   -1.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5412   -1.0832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1581    0.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1581    0.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5495    1.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2572    0.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2572    0.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8644    1.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7195    2.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5321    2.2450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9407    2.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1416    2.7374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6537    1.2870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6673   -3.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5420   -2.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7536   -2.8733    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.5321    3.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1235    4.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  1  7  1  0
  3  8  1  0
  8  9  1  0
  9 10  1  0
  5 10  1  1
  4 11  1  0
  5 12  1  0
 12 13  1  0
 13 11  1  0
  7 14  1  1
  8 15  1  1
  4 16  1  6
 13 17  1  6
 11 18  2  0
  6 19  1  6
  2 20  1  6
 20 21  1  0
 21 22  2  0
 23 14  2  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 14 27  1  0
 26 28  1  0
 25 29  1  0
 29 30  1  0
 30 28  1  0
 31 30  1  0
 29 32  2  0
 28 33  2  0
  3 34  1  6
 21 35  1  0
 35 36  1  0
 31 37  1  0
 37 38  3  0
M  END

Alternative Forms

  1. Parent:

    ALA5083529

    ---

Associated Targets(Human)

ES-2 (58 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.06Molecular Weight (Monoisotopic): 545.2180AlogP: 2.24#Rotatable Bonds: 4
Polar Surface Area: 121.21Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: 2.26CX LogD: 2.26
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: 1.57

References

1.  (2020)  Compounds that induce ferroptic cell death, 

Source