The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5083529
PubChem CID: 137530048
Max Phase: Preclinical
Molecular Formula: C29H36ClNO7
Molecular Weight: 546.06
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN1C(=O)C2CC=C([C@@H]3C[C@@H](OC(=O)CCl)[C@]4(C)[C@H](C)CC[C@]5(C[C@H](O)C(=O)[C@]54O)[C@H]3C)CC2C1=O
Standard InChI: InChI=1S/C29H36ClNO7/c1-5-10-31-25(35)18-7-6-17(11-20(18)26(31)36)19-12-22(38-23(33)14-30)27(4)15(2)8-9-28(16(19)3)13-21(32)24(34)29(27,28)37/h1,6,15-16,18-22,32,37H,7-14H2,2-4H3/t15-,16+,18?,19-,20?,21+,22-,27+,28+,29-/m1/s1
Standard InChI Key: UQINDGRIYWGWCE-OPZZZPQTSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-0.1933 -1.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3856 -2.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1220 -2.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9461 -2.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4671 -2.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2892 -1.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5495 -1.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2901 -3.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5162 -3.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4548 -3.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3841 -3.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2271 -2.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1758 -3.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5495 -0.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8679 -4.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5981 -2.1492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7536 -3.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1726 -4.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8671 -0.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1749 -2.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7527 -1.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5412 -1.0832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1581 0.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1581 0.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5495 1.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2572 0.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2572 0.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8644 1.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7195 2.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5321 2.2450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9407 2.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1416 2.7374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6537 1.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6673 -3.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5420 -2.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7536 -2.8733 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5321 3.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1235 4.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
7 6 1 0
1 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
5 10 1 1
4 11 1 0
5 12 1 0
12 13 1 0
13 11 1 0
7 14 1 1
8 15 1 1
4 16 1 6
13 17 1 6
11 18 2 0
6 19 1 6
2 20 1 6
20 21 1 0
21 22 2 0
23 14 2 0
24 23 1 0
25 24 1 0
26 25 1 0
27 26 1 0
14 27 1 0
26 28 1 0
25 29 1 0
29 30 1 0
30 28 1 0
31 30 1 0
29 32 2 0
28 33 2 0
3 34 1 6
21 35 1 0
35 36 1 0
31 37 1 0
37 38 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.06Molecular Weight (Monoisotopic): 545.2180AlogP: 2.24#Rotatable Bonds: 4Polar Surface Area: 121.21Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.20CX Basic pKa: ┄CX LogP: 2.26CX LogD: 2.26Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: 1.57
References 1. (2020) Compounds that induce ferroptic cell death,