6-hydroxy-7,8-dimethoxy-4,4,5-trimethylchroman-2-one

ID: ALA5084036

PubChem CID: 622325

Max Phase: Preclinical

Molecular Formula: C14H18O5

Molecular Weight: 266.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(O)c(C)c2c(c1OC)OC(=O)CC2(C)C

Standard InChI:  InChI=1S/C14H18O5/c1-7-9-11(19-8(15)6-14(9,2)3)13(18-5)12(17-4)10(7)16/h16H,6H2,1-5H3

Standard InChI Key:  NYBQQTPBIGPPMU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   33.4872   -3.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2017   -3.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9162   -3.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9162   -2.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6307   -3.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3451   -3.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0505   -2.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8755   -2.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0596   -3.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0596   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3451   -5.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7741   -5.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6307   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9162   -5.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9162   -5.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2017   -6.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2017   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4872   -5.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7727   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
  5 13  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  2  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
M  END

Associated Targets(Human)

Fibroblast (163371 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 266.29Molecular Weight (Monoisotopic): 266.1154AlogP: 2.30#Rotatable Bonds: 2
Polar Surface Area: 64.99Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.30CX Basic pKa: CX LogP: 2.37CX LogD: 2.37
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.66Np Likeness Score: 1.52

References

1. Tantak MP, Sekhar V, Tao X, Zhai RG, Phanstiel O..  (2021)  Development of a Redox-Sensitive Spermine Prodrug for the Potential Treatment of Snyder Robinson Syndrome.,  64  (21.0): [PMID:34695351] [10.1021/acs.jmedchem.1c00419]

Source