The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl-2-(5-(2-(benzo[d]oxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxamido)-1,3,4-thiadiazol-2-yl)acetate ID: ALA5084217
PubChem CID: 156899018
Max Phase: Preclinical
Molecular Formula: C24H20ClN7O4S
Molecular Weight: 537.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cc1nnc(NC(=O)C2=C(C)NC(Nc3nc4ccccc4o3)=NC2c2ccccc2Cl)s1
Standard InChI: InChI=1S/C24H20ClN7O4S/c1-12-19(21(34)29-24-32-31-17(37-24)11-18(33)35-2)20(13-7-3-4-8-14(13)25)28-22(26-12)30-23-27-15-9-5-6-10-16(15)36-23/h3-10,20H,11H2,1-2H3,(H,29,32,34)(H2,26,27,28,30)
Standard InChI Key: WHKBSNWEPKITDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
11.0196 -8.4281 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.0332 -7.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0332 -6.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0466 -6.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0561 -6.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0561 -7.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0490 -8.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0490 -9.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0626 -10.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0761 -9.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0895 -10.1771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1030 -9.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1031 -8.4218 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.2435 -8.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9111 -8.9941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2133 -9.9408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2435 -6.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2570 -6.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2570 -5.1414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2705 -6.8968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2840 -6.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0761 -8.4216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0626 -11.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0760 -11.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0490 -11.9324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0355 -11.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0221 -11.9325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0086 -11.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8864 -10.1841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7422 -9.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1545 -8.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9856 -8.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4059 -9.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9912 -10.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1573 -10.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9401 -11.8230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0355 -10.1771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
7 6 1 0
2 7 2 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
12 11 1 0
13 12 1 0
13 14 1 0
14 15 2 0
16 15 1 0
12 16 2 0
14 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
10 22 2 0
23 9 2 0
23 24 1 0
25 23 1 0
26 25 1 0
26 27 1 0
27 28 1 0
29 28 2 0
30 29 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
35 34 1 0
35 30 2 0
36 35 1 0
36 28 1 0
37 26 2 0
37 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.99Molecular Weight (Monoisotopic): 537.0986AlogP: 4.07#Rotatable Bonds: 6Polar Surface Area: 143.63Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.82CX Basic pKa: 4.10CX LogP: 3.56CX LogD: 2.95Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.47
References 1. (2021) Galactokinase inhibitors,