1-(3-((S)-3-fluoropyrrolidin-1-yl)phenyl)-4-(4-(pyrimidin-2-yl)piperazin-1-yl)pyrrolidin-2-one

ID: ALA5084732

PubChem CID: 166635881

Max Phase: Preclinical

Molecular Formula: C22H27FN6O

Molecular Weight: 410.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CC(N2CCN(c3ncccn3)CC2)CN1c1cccc(N2CC[C@H](F)C2)c1

Standard InChI:  InChI=1S/C22H27FN6O/c23-17-5-8-28(15-17)18-3-1-4-19(13-18)29-16-20(14-21(29)30)26-9-11-27(12-10-26)22-24-6-2-7-25-22/h1-4,6-7,13,17,20H,5,8-12,14-16H2/t17-,20?/m0/s1

Standard InChI Key:  CTFLAACDFPXTRN-DIMJTDRSSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   23.4454  -24.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4442  -25.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1523  -25.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8619  -25.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8591  -24.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1505  -24.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5653  -24.2453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3127  -24.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8572  -23.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4459  -23.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6473  -23.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0377  -22.8856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6702  -24.0453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0027  -24.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8120  -24.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2934  -24.2160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9596  -23.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1444  -23.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1061  -24.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4344  -25.0507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2463  -25.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7275  -24.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3910  -23.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5801  -23.6434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1539  -26.7037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4972  -27.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7506  -27.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5657  -27.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8158  -27.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2717  -28.6203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  2  0
  9 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  3 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
 27 30  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5084732

    ---

Associated Targets(non-human)

Mgll Monoglyceride lipase (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 410.50Molecular Weight (Monoisotopic): 410.2230AlogP: 1.95#Rotatable Bonds: 4
Polar Surface Area: 55.81Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.61CX LogP: 1.84CX LogD: 1.78
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.77Np Likeness Score: -1.50

References

1. He Y, Schild M, Grether U, Benz J, Leibrock L, Heer D, Topp A, Collin L, Kuhn B, Wittwer M, Keller C, Gobbi LC, Schibli R, Mu L..  (2022)  Development of High Brain-Penetrant and Reversible Monoacylglycerol Lipase PET Tracers for Neuroimaging.,  65  (3.0): [PMID:35089028] [10.1021/acs.jmedchem.1c01706]

Source