The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1,2-benzoxazol-3-yl)-2-(1,3-benzoxazol-2-ylamino)-4-(4-chloro-1-methyl-pyrazol-3-yl)-6-methyl-1,4-dihydropyrimidine-5-carboxamide ID: ALA5084931
PubChem CID: 46926076
Max Phase: Preclinical
Molecular Formula: C24H19ClN8O3
Molecular Weight: 502.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2noc3ccccc23)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C24H19ClN8O3/c1-12-18(22(34)29-21-13-7-3-5-9-16(13)36-32-21)20(19-14(25)11-33(2)31-19)28-23(26-12)30-24-27-15-8-4-6-10-17(15)35-24/h3-11,20H,1-2H3,(H,29,32,34)(H2,26,27,28,30)
Standard InChI Key: NXSRRNBLWSIULY-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-0.8022 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8022 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6266 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0877 1.2381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6266 0.0005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0877 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3413 1.2381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0560 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8095 1.1610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3615 0.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9491 -0.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1422 0.0052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5965 -0.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1838 0.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1878 -0.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3634 -0.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5169 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2316 0.0005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5169 -1.2372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2316 -1.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3178 -2.4701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1247 -2.6416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5371 -1.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9851 -1.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0877 -1.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5169 1.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2704 0.9027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8224 1.5157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4100 2.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6031 2.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0199 2.6416 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.6471 1.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3414 -1.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5965 -0.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0486 -0.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2413 -0.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 4 2 0
2 4 1 0
5 3 1 0
6 5 1 0
1 6 2 0
3 7 1 0
7 8 1 0
9 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
13 14 2 0
10 14 1 0
15 13 1 0
16 15 2 0
11 16 1 0
1 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
21 20 2 0
21 22 1 0
22 23 1 0
23 24 2 0
24 20 1 0
6 25 1 0
26 2 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
30 26 1 0
30 31 1 0
28 32 1 0
23 33 1 0
34 33 2 0
35 34 1 0
36 35 2 0
24 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.92Molecular Weight (Monoisotopic): 502.1269AlogP: 4.38#Rotatable Bonds: 4Polar Surface Area: 135.40Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.77CX Basic pKa: 3.29CX LogP: 3.58CX LogD: 3.56Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.39
References 1. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,