N-(1,2-benzoxazol-3-yl)-2-(1,3-benzoxazol-2-ylamino)-4-(4-chloro-1-methyl-pyrazol-3-yl)-6-methyl-1,4-dihydropyrimidine-5-carboxamide

ID: ALA5084931

PubChem CID: 46926076

Max Phase: Preclinical

Molecular Formula: C24H19ClN8O3

Molecular Weight: 502.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)Nc2noc3ccccc23)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1

Standard InChI:  InChI=1S/C24H19ClN8O3/c1-12-18(22(34)29-21-13-7-3-5-9-16(13)36-32-21)20(19-14(25)11-33(2)31-19)28-23(26-12)30-24-27-15-8-4-6-10-17(15)35-24/h3-11,20H,1-2H3,(H,29,32,34)(H2,26,27,28,30)

Standard InChI Key:  NXSRRNBLWSIULY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -0.8022    0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8022    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6266    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0877    1.2381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6266    0.0005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0877   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3413    1.2381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0560    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8095    1.1610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3615    0.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9491   -0.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1422    0.0052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5965   -0.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1838    0.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1878   -0.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3634   -0.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5169   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2316    0.0005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5169   -1.2372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2316   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3178   -2.4701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1247   -2.6416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5371   -1.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9851   -1.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0877   -1.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5169    1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2704    0.9027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8224    1.5157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4100    2.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6031    2.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0199    2.6416    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.6471    1.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3414   -1.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5965   -0.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0486   -0.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2413   -0.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  4  2  0
  2  4  1  0
  5  3  1  0
  6  5  1  0
  1  6  2  0
  3  7  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  2  0
 13 14  2  0
 10 14  1  0
 15 13  1  0
 16 15  2  0
 11 16  1  0
  1 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 21 20  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
  6 25  1  0
 26  2  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 30 31  1  0
 28 32  1  0
 23 33  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 24 36  1  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.92Molecular Weight (Monoisotopic): 502.1269AlogP: 4.38#Rotatable Bonds: 4
Polar Surface Area: 135.40Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.77CX Basic pKa: 3.29CX LogP: 3.58CX LogD: 3.56
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.39

References

1.  (2019)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 

Source