The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((S)-1-amino-3-cyclohexyl-1-oxopropan-2-yl)-2-(3,3-diphenylacrylamido)-5-guanidinopentanamide ID: ALA5085023
PubChem CID: 166631261
Max Phase: Preclinical
Molecular Formula: C30H40N6O3
Molecular Weight: 532.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](NC(=O)C=C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(N)=O
Standard InChI: InChI=1S/C30H40N6O3/c31-28(38)26(19-21-11-4-1-5-12-21)36-29(39)25(17-10-18-34-30(32)33)35-27(37)20-24(22-13-6-2-7-14-22)23-15-8-3-9-16-23/h2-3,6-9,13-16,20-21,25-26H,1,4-5,10-12,17-19H2,(H2,31,38)(H,35,37)(H,36,39)(H4,32,33,34)/t25-,26+/m1/s1
Standard InChI Key: MDEKUXJFTPZLIL-FTJBHMTQSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
13.4781 -15.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4770 -16.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1850 -16.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8947 -16.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8918 -15.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1832 -14.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5980 -14.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3073 -15.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0134 -14.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0103 -14.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7227 -15.3431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4288 -14.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1381 -15.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8442 -14.9265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4257 -14.1147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1319 -13.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1288 -12.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8350 -12.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8319 -11.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5381 -11.2465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1227 -11.2519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5535 -15.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1411 -16.1550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2596 -14.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2566 -14.1040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9689 -15.3271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5951 -14.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3028 -13.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3001 -12.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5903 -12.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8818 -12.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8881 -13.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5565 -16.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2658 -16.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2644 -17.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9696 -17.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6781 -17.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6770 -16.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9673 -16.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 6
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
14 22 1 0
13 23 2 0
22 24 1 0
24 25 2 0
24 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
7 27 1 0
22 33 1 6
33 34 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.69Molecular Weight (Monoisotopic): 532.3162AlogP: 2.81#Rotatable Bonds: 13Polar Surface Area: 163.19Molecular Species: BASEHBA: 4HBD: 6#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.54CX Basic pKa: 11.85CX LogP: 2.59CX LogD: 0.49Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.10Np Likeness Score: 0.12
References 1. Quillet R, Schneider S, Utard V, Drieu la Rochelle A, Elhabazi K, Henningsen JB, Gizzi P, Schmitt M, Kugler V, Simonneaux V, Ilien B, Simonin F, Bihel F.. (2021) Identification of an N -acylated-D Arg-Leu-NH2 Dipeptide as a Highly Selective Neuropeptide FF1 Receptor Antagonist That Potently Prevents Opioid-Induced Hyperalgesia., 64 (11.0): [PMID:34008968 ] [10.1021/acs.jmedchem.1c00256 ]