2-[[7-acetyl-3-(5-methyl-2-furyl)-4-oxo-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N-(5-chloro-2-methyl-phenyl)acetamide

ID: ALA5085041

PubChem CID: 166631626

Max Phase: Preclinical

Molecular Formula: C25H23ClN4O4S2

Molecular Weight: 543.07

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCc2c(sc3nc(SCC(=O)Nc4cc(Cl)ccc4C)n(-c4ccc(C)o4)c(=O)c23)C1

Standard InChI:  InChI=1S/C25H23ClN4O4S2/c1-13-4-6-16(26)10-18(13)27-20(32)12-35-25-28-23-22(24(33)30(25)21-7-5-14(2)34-21)17-8-9-29(15(3)31)11-19(17)36-23/h4-7,10H,8-9,11-12H2,1-3H3,(H,27,32)

Standard InChI Key:  QLJIXYHURRRAKA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -1.3842   -0.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6696    0.2900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0447   -0.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0447   -0.9474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6696   -1.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3842   -0.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1688   -1.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6537   -0.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1688    0.1325    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4744   -0.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8101   -1.3746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3250   -2.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5045   -1.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6354   -1.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0480   -2.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0480   -0.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6696   -2.1852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7595    0.2902    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4743   -0.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1891    0.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9038   -0.1222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1891    1.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6184    0.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6186    1.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3314    1.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0464    1.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0480    0.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3363   -0.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3314    2.3518    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.3363   -0.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7594   -1.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5129   -1.0245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0649   -1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6525   -2.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8456   -2.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8902   -1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  6  7  1  0
  7  8  2  0
  1  9  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
  7 13  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 14 16  2  0
  5 17  2  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 25 29  1  0
 28 30  1  0
  4 31  1  0
 32 31  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 31  2  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5085041

    ---

Associated Targets(Human)

BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.07Molecular Weight (Monoisotopic): 542.0849AlogP: 4.95#Rotatable Bonds: 5
Polar Surface Area: 97.44Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.46CX Basic pKa: CX LogP: 4.46CX LogD: 4.46
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -2.50

References

1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S..  (2022)  CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation.,  65  (7.0): [PMID:35348328] [10.1021/acs.jmedchem.1c02168]

Source