4-(5-bromothiophene-2-carbonyl)-5-(3,5-dimethylphenyl)-7-methyl-4,5-dihydro-1H-benzo[e][1,4]diazepin-2(3H)-one

ID: ALA5085334

PubChem CID: 166632839

Max Phase: Preclinical

Molecular Formula: C23H21BrN2O2S

Molecular Weight: 469.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(C2c3cc(C)ccc3NC(=O)CN2C(=O)c2ccc(Br)s2)c1

Standard InChI:  InChI=1S/C23H21BrN2O2S/c1-13-4-5-18-17(11-13)22(16-9-14(2)8-15(3)10-16)26(12-21(27)25-18)23(28)19-6-7-20(24)29-19/h4-11,22H,12H2,1-3H3,(H,25,27)

Standard InChI Key:  NIPTUMFVYBXSMZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   32.2289  -11.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2278  -12.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9425  -13.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9407  -11.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5129  -13.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0735  -13.1030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4054  -12.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0293  -11.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2873  -13.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6591  -12.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6561  -11.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2577  -11.4829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1137  -14.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3264  -14.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1511  -15.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7622  -15.7101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5512  -15.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7228  -14.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5250  -10.9941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6052  -13.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3249  -14.5097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4174  -13.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0098  -14.1571    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.7374  -13.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5922  -12.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7750  -12.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4798  -14.1280    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   32.3653  -15.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1639  -16.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 10  2  0
 11  4  2  0
  4  1  1  0
  2  5  1  0
  6  7  1  0
  7  8  1  0
  6  9  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  9 10  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  9 13  1  0
  8 19  2  0
  6 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  2  0
 24 27  1  0
 15 28  1  0
 17 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5085334

    ---

Associated Targets(Human)

PRMT6 Tchem Protein arginine N-methyltransferase 6 (321 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.40Molecular Weight (Monoisotopic): 468.0507AlogP: 5.62#Rotatable Bonds: 2
Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: CX LogP: 6.11CX LogD: 6.11
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -1.20

References

1. Shen Y, Li F, Szewczyk MM, Halabelian L, Chau I, Eram MS, Dela Seña C, Park KS, Meng F, Chen H, Zeng H, Dong A, Wu H, Trush VV, McLeod D, Zepeda-Velázquez CA, Campbell RM, Mader MM, Watson BM, Schapira M, Arrowsmith CH, Al-Awar R, Barsyte-Lovejoy D, Kaniskan HÜ, Brown PJ, Vedadi M, Jin J..  (2021)  A First-in-Class, Highly Selective and Cell-Active Allosteric Inhibitor of Protein Arginine Methyltransferase 6.,  64  (7.0): [PMID:33591753] [10.1021/acs.jmedchem.0c02160]

Source