N-(4-((3-bromophenyl)sulfonamido)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5085556

PubChem CID: 166631934

Max Phase: Preclinical

Molecular Formula: C17H12BrN3O6S

Molecular Weight: 466.27

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(NS(=O)(=O)c2cccc(Br)c2)cc1)c1ccc([N+](=O)[O-])o1

Standard InChI:  InChI=1S/C17H12BrN3O6S/c18-11-2-1-3-14(10-11)28(25,26)20-13-6-4-12(5-7-13)19-17(22)15-8-9-16(27-15)21(23)24/h1-10,20H,(H,19,22)

Standard InChI Key:  QWUODIUGMJYHNK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    9.3440   -4.7298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1336   -3.9415    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.5561   -4.5179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4008   -6.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2180   -6.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4724   -5.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8094   -4.9692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1507   -5.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3710   -5.1969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7640   -5.7440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2007   -4.3976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2499   -5.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8564   -5.7475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4209   -4.4008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1985   -4.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8033   -4.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5802   -4.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7518   -3.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1404   -3.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3658   -3.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5291   -3.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9135   -3.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5180   -4.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2973   -3.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4696   -3.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8564   -2.6349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0794   -2.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0248   -1.8352    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  9 10  2  0
  9 11  1  0
  8  9  1  0
  6 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21  2  1  0
  2 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 26 28  1  0
M  CHG  2   9   1  11  -1
M  END

Alternative Forms

  1. Parent:

    ALA5085556

    ---

Associated Targets(non-human)

Slc14a1 Urea transporter 1 (102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc14a1 Urea transporter 1 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.27Molecular Weight (Monoisotopic): 464.9630AlogP: 4.00#Rotatable Bonds: 6
Polar Surface Area: 131.55Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.80CX Basic pKa: CX LogP: 3.41CX LogD: 3.28
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.42Np Likeness Score: -2.16

References

1. Wang S, Xu Y, Zhao Y, Zhang S, Li M, Li X, He J, Zhou H, Ge Z, Li R, Yang B..  (2021)  N-(4-acetamidophenyl)-5-acetylfuran-2-carboxamide as a novel orally available diuretic that targets urea transporters with improved PD and PK properties.,  226  [PMID:34601246] [10.1016/j.ejmech.2021.113859]

Source