The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-1-((S)-2-(2-(2-(2-((4-((2-Aminophenyl)carbamoyl)-phenyl)amino)-2-oxoethoxy)ethoxy)acetamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide ID: ALA5086099
PubChem CID: 166635273
Max Phase: Preclinical
Molecular Formula: C41H49N7O8S
Molecular Weight: 799.95
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)COCCOCC(=O)Nc2ccc(C(=O)Nc3ccccc3N)cc2)C(C)(C)C)cc1
Standard InChI: InChI=1S/C41H49N7O8S/c1-25-36(57-24-44-25)27-11-9-26(10-12-27)20-43-39(53)33-19-30(49)21-48(33)40(54)37(41(2,3)4)47-35(51)23-56-18-17-55-22-34(50)45-29-15-13-28(14-16-29)38(52)46-32-8-6-5-7-31(32)42/h5-16,24,30,33,37,49H,17-23,42H2,1-4H3,(H,43,53)(H,45,50)(H,46,52)(H,47,51)/t30-,33+,37-/m1/s1
Standard InChI Key: LDFNYUSMNVVOAO-FHRXIHKVSA-N
Molfile:
RDKit 2D
57 61 0 0 0 0 0 0 0 0999 V2000
-4.8266 -0.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8266 0.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5412 0.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2558 0.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3995 0.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3995 1.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1140 1.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8285 1.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8285 0.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1140 0.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1140 -0.6476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.6849 0.1773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9703 0.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9703 1.4149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2558 -0.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5412 -1.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1120 -1.0602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3976 -0.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3976 0.1773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6830 -1.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9684 -0.6476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2539 -1.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5393 -0.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8896 -0.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1751 -1.0602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6041 -1.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.8853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3187 -0.6475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0333 -1.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7478 -0.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4624 -1.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7478 0.1775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4153 0.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 0.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8133 0.9597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3716 -0.3993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1564 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7695 -0.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5978 0.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2110 1.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9957 1.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6089 1.5540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5226 2.3746 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2765 2.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8285 2.0971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4160 1.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7516 0.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1673 0.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5543 -0.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1603 1.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3352 1.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8502 2.1147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0803 0.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0333 -1.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7479 -2.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3188 -2.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0334 -2.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
10 5 1 0
9 10 2 0
10 11 1 0
5 12 1 0
13 4 1 0
12 13 1 0
13 14 2 0
4 15 1 0
16 1 1 0
15 16 2 0
1 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 1 0
23 25 1 0
26 24 1 0
26 27 2 0
26 28 1 0
29 28 1 6
29 30 1 0
30 31 2 0
30 32 1 0
33 32 1 0
33 34 1 1
34 35 2 0
34 36 1 0
36 37 1 0
37 38 1 0
39 38 2 0
40 39 1 0
41 40 2 0
42 41 1 0
42 43 1 0
43 44 1 0
44 45 2 0
45 46 1 0
46 42 2 0
46 47 1 0
48 41 1 0
49 48 2 0
38 49 1 0
33 50 1 0
50 51 1 0
51 52 1 6
51 53 1 0
53 32 1 0
29 54 1 0
54 55 1 0
54 56 1 0
54 57 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 799.95Molecular Weight (Monoisotopic): 799.3363AlogP: 3.73#Rotatable Bonds: 16Polar Surface Area: 214.31Molecular Species: NEUTRALHBA: 11HBD: 6#RO5 Violations: 3HBA (Lipinski): 15HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.91CX Basic pKa: 3.24CX LogP: 1.62CX LogD: 1.62Aromatic Rings: 4Heavy Atoms: 57QED Weighted: 0.07Np Likeness Score: -0.92
References 1. Smalley JP, Baker IM, Pytel WA, Lin LY, Bowman KJ, Schwabe JWR, Cowley SM, Hodgkinson JT.. (2022) Optimization of Class I Histone Deacetylase PROTACs Reveals that HDAC1/2 Degradation is Critical to Induce Apoptosis and Cell Arrest in Cancer Cells., 65 (7.0): [PMID:35293758 ] [10.1021/acs.jmedchem.1c02179 ]