2-[[7-acetyl-3-(2-furylmethyl)-4-oxo-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N-(4-acetylphenyl)acetamide

ID: ALA5086321

Cas Number: 1189944-52-2

PubChem CID: 50799637

Max Phase: Preclinical

Molecular Formula: C26H24N4O5S2

Molecular Weight: 536.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)c1ccc(NC(=O)CSc2nc3sc4c(c3c(=O)n2Cc2ccco2)CCN(C(C)=O)C4)cc1

Standard InChI:  InChI=1S/C26H24N4O5S2/c1-15(31)17-5-7-18(8-6-17)27-22(33)14-36-26-28-24-23(25(34)30(26)12-19-4-3-11-35-19)20-9-10-29(16(2)32)13-21(20)37-24/h3-8,11H,9-10,12-14H2,1-2H3,(H,27,33)

Standard InChI Key:  HNQWNNUKTSPZBM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -2.0982    0.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3837    0.8435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6692    0.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3837   -0.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0982   -0.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8828    0.6859    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8828   -0.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3678    0.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2185   -1.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0391   -1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5240   -0.8213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1883   -0.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3493   -0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7620   -1.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7620   -0.1065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3837   -1.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0454    0.8436    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7601    0.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4749    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1897    0.4310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4749    1.6690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0454   -0.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0454   -1.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7128   -2.1203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4579   -2.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3669   -2.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6218   -2.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6692   -0.3940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9043    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9046    1.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6176    2.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3325    1.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3341    0.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6222    0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0472    2.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0472    2.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7620    1.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  1  5  2  0
  5  4  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  6  1  0
  7  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
  8 12  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
  4 16  2  0
  3 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 28 22  1  0
  4 28  1  0
  3 28  1  0
 20 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 32 35  1  0
 35 36  2  0
 35 37  1  0
M  END

Associated Targets(Human)

BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.64Molecular Weight (Monoisotopic): 536.1188AlogP: 3.94#Rotatable Bonds: 7
Polar Surface Area: 114.51Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.17CX Basic pKa: 2.07CX LogP: 2.60CX LogD: 2.60
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -2.52

References

1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S..  (2022)  CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation.,  65  (7.0): [PMID:35348328] [10.1021/acs.jmedchem.1c02168]

Source