The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(7-acetyl-4-oxo-3-phenyl-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl)sulfanyl]-N-phenyl-acetamide ID: ALA5086436
PubChem CID: 50799845
Max Phase: Preclinical
Molecular Formula: C25H22N4O3S2
Molecular Weight: 490.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCc2c(sc3nc(SCC(=O)Nc4ccccc4)n(-c4ccccc4)c(=O)c23)C1
Standard InChI: InChI=1S/C25H22N4O3S2/c1-16(30)28-13-12-19-20(14-28)34-23-22(19)24(32)29(18-10-6-3-7-11-18)25(27-23)33-15-21(31)26-17-8-4-2-5-9-17/h2-11H,12-15H2,1H3,(H,26,31)
Standard InChI Key: YRMIKSNPPWBQJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.3843 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6698 0.8255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0447 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0447 -0.4120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6698 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3843 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1689 0.6679 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1689 -0.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6538 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5045 -1.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3251 -1.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8100 -0.8393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4744 -0.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6353 -0.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0480 -1.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0480 -0.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6698 -1.6498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7593 0.8256 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4741 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1889 0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9036 0.4130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1889 1.6510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6183 0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7593 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4743 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1865 -0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1865 -1.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4761 -2.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7593 -1.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3361 0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0480 0.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3315 2.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0465 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6186 1.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 1 0
1 6 2 0
6 5 1 0
1 7 1 0
6 8 1 0
8 9 2 0
9 7 1 0
8 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
9 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
5 17 2 0
3 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
24 4 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
24 29 1 0
29 28 2 0
23 30 1 0
31 30 2 0
33 32 2 0
33 31 1 0
32 34 1 0
34 23 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.61Molecular Weight (Monoisotopic): 490.1133AlogP: 4.08#Rotatable Bonds: 5Polar Surface Area: 84.30Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.64CX Basic pKa: 0.47CX LogP: 3.92CX LogD: 3.92Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -2.44
References 1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S.. (2022) CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation., 65 (7.0): [PMID:35348328 ] [10.1021/acs.jmedchem.1c02168 ]