2-[(7-acetyl-4-oxo-3-phenyl-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl)sulfanyl]-N-phenyl-acetamide

ID: ALA5086436

PubChem CID: 50799845

Max Phase: Preclinical

Molecular Formula: C25H22N4O3S2

Molecular Weight: 490.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCc2c(sc3nc(SCC(=O)Nc4ccccc4)n(-c4ccccc4)c(=O)c23)C1

Standard InChI:  InChI=1S/C25H22N4O3S2/c1-16(30)28-13-12-19-20(14-28)34-23-22(19)24(32)29(18-10-6-3-7-11-18)25(27-23)33-15-21(31)26-17-8-4-2-5-9-17/h2-11H,12-15H2,1H3,(H,26,31)

Standard InChI Key:  YRMIKSNPPWBQJA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -1.3843    0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6698    0.8255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0447    0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0447   -0.4120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6698   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3843   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1689    0.6679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1689   -0.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6538    0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5045   -1.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3251   -1.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8100   -0.8393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4744   -0.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6353   -0.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0480   -1.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0480   -0.1245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6698   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7593    0.8256    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4741    0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1889    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9036    0.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1889    1.6510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6183    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7593   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4743   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1865   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1865   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4761   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7593   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3361    0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0480    0.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3315    2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0465    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6186    1.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  1  7  1  0
  6  8  1  0
  8  9  2  0
  9  7  1  0
  8 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  9 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
  5 17  2  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 24  4  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 24 29  1  0
 29 28  2  0
 23 30  1  0
 31 30  2  0
 33 32  2  0
 33 31  1  0
 32 34  1  0
 34 23  2  0
M  END

Associated Targets(Human)

BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.61Molecular Weight (Monoisotopic): 490.1133AlogP: 4.08#Rotatable Bonds: 5
Polar Surface Area: 84.30Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.64CX Basic pKa: 0.47CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -2.44

References

1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S..  (2022)  CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation.,  65  (7.0): [PMID:35348328] [10.1021/acs.jmedchem.1c02168]

Source