The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-chloro-4-(((cyclohexylmethyl)(propyl)amino)methyl)phenyl)-2-(4-(methylsulfonyl)phenyl)acetamide ID: ALA5086647
PubChem CID: 166631325
Max Phase: Preclinical
Molecular Formula: C26H35ClN2O3S
Molecular Weight: 491.10
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCN(Cc1ccc(NC(=O)Cc2ccc(S(C)(=O)=O)cc2)cc1Cl)CC1CCCCC1
Standard InChI: InChI=1S/C26H35ClN2O3S/c1-3-15-29(18-21-7-5-4-6-8-21)19-22-11-12-23(17-25(22)27)28-26(30)16-20-9-13-24(14-10-20)33(2,31)32/h9-14,17,21H,3-8,15-16,18-19H2,1-2H3,(H,28,30)
Standard InChI Key: UCJKFMKCLURICR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
38.4782 -6.9255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8909 -7.6354 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.2993 -6.9230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5253 -8.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5241 -8.8717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2322 -9.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9418 -8.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9390 -8.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2304 -7.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6502 -9.2787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3573 -8.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0656 -9.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3560 -8.0518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7727 -8.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4797 -9.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1863 -8.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1855 -8.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4721 -7.6412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7685 -8.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6009 -8.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8175 -7.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1099 -8.0525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4020 -7.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6944 -8.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1100 -8.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4024 -9.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4026 -10.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9891 -7.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2836 -8.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2796 -8.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9873 -9.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6989 -8.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2279 -6.8261 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 2 1 0
2 20 1 0
4 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
24 28 1 0
24 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
9 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.10Molecular Weight (Monoisotopic): 490.2057AlogP: 5.72#Rotatable Bonds: 10Polar Surface Area: 66.48Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.64CX Basic pKa: 8.99CX LogP: 5.42CX LogD: 3.82Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.87