The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12beta-acetoxy-7alpha,19-dihydroxygorgosterol ID: ALA508686
PubChem CID: 11730989
Max Phase: Preclinical
Molecular Formula: C32H52O5
Molecular Weight: 516.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H]1C[C@H]2[C@@H]([C@H](O)C=C3C[C@@H](O)CC[C@@]32CO)[C@@H]2CC[C@H]([C@H](C)[C@H]3C[C@]3(C)[C@H](C)C(C)C)[C@@]12C
Standard InChI: InChI=1S/C32H52O5/c1-17(2)19(4)30(6)15-26(30)18(3)23-8-9-24-29-25(14-28(31(23,24)7)37-20(5)34)32(16-33)11-10-22(35)12-21(32)13-27(29)36/h13,17-19,22-29,33,35-36H,8-12,14-16H2,1-7H3/t18-,19+,22-,23+,24-,25-,26+,27+,28+,29-,30+,31+,32+/m0/s1
Standard InChI Key: YRZCADRKQLYEGU-YRMWXLKQSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
4.2800 -0.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2800 -1.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9905 -1.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9905 -0.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7052 -0.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7068 -1.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4158 -1.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1342 -1.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4168 -0.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1262 -0.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1338 1.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8474 0.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8420 -0.1376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6241 -0.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1076 0.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6287 0.9349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5626 -1.7838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6982 0.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8360 -0.9592 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.1423 1.9262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4282 2.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4325 3.1681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7098 1.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1270 0.2880 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4248 -0.7186 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.0576 1.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8862 1.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3385 2.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4504 0.9359 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6964 1.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2434 1.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5080 2.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0286 0.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9551 0.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6737 1.2711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9547 0.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2403 -0.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6728 -0.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8501 -1.7809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9111 2.6874 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.4075 0.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9820 0.6851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 2 0
7 8 1 0
8 10 1 0
9 10 1 0
9 41 1 0
10 13 1 0
12 11 1 0
11 41 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
2 17 1 1
5 18 1 1
10 19 1 1
11 20 1 1
20 21 1 0
21 22 2 0
21 23 1 0
9 24 1 6
13 25 1 6
12 26 1 1
16 27 1 0
27 30 1 0
27 28 1 6
16 29 1 6
31 30 1 0
32 31 1 0
30 32 1 0
31 33 1 1
31 34 1 0
34 35 1 6
34 36 1 0
36 37 1 0
36 38 1 0
8 39 1 6
30 40 1 6
1 2 1 0
18 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.76Molecular Weight (Monoisotopic): 516.3815AlogP: 5.37#Rotatable Bonds: 6Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.14CX LogD: 4.14Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: 3.17
References 1. Wright AD, Goclik E, König GM.. (2003) Oxygenated analogues of gorgosterol and ergosterol from the soft coral Capnella lacertiliensis., 66 (2): [PMID:12608844 ] [10.1021/np0200111 ]