The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ajmalicine ID: ALA5086982
PubChem CID: 3010369
Max Phase: Preclinical
Molecular Formula: C20H22N2O3
Molecular Weight: 338.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=COC[C@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@H]12
Standard InChI: InChI=1S/C20H22N2O3/c1-24-20(23)16-11-25-10-12-9-22-7-6-14-13-4-2-3-5-17(13)21-19(14)18(22)8-15(12)16/h2-5,11-12,15,18,21H,6-10H2,1H3/t12-,15+,18+/m1/s1
Standard InChI Key: SFLBNAROMBKKJF-MRAWALMUSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
10.7583 -13.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7571 -14.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4652 -14.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4634 -12.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1720 -13.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1723 -14.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9552 -14.3716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9548 -13.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4390 -13.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1076 -12.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2859 -12.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5918 -12.8702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2502 -13.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7284 -14.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4115 -12.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8345 -14.3256 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.8920 -13.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5486 -14.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0221 -14.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8414 -14.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1848 -14.0539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7090 -13.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2943 -12.7490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.3327 -14.9942 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.6802 -15.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8664 -15.6936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5245 -16.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1520 -16.2858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 1 0
12 15 1 0
13 14 1 0
14 18 1 0
17 15 1 0
13 16 1 6
17 18 1 0
17 22 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
17 23 1 1
18 24 1 6
19 25 1 0
25 26 1 0
26 27 1 0
25 28 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 338.41Molecular Weight (Monoisotopic): 338.1630AlogP: 2.79#Rotatable Bonds: 1Polar Surface Area: 54.56Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.13CX LogP: 2.14CX LogD: 1.95Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.81Np Likeness Score: 0.98
References 1. León F, Obeng S, Mottinelli M, Chen Y, King TI, Berthold EC, Kamble SH, Restrepo LF, Patel A, Gamez-Jimenez LR, Lopera-Londoño C, Hiranita T, Sharma A, Hampson AJ, Canal CE, McMahon LR, McCurdy CR.. (2021) Activity of Mitragyna speciosa ("Kratom") Alkaloids at Serotonin Receptors., 64 (18.0): [PMID:34467758 ] [10.1021/acs.jmedchem.1c00726 ]