1-(3-(2-fluoropyridin-3-yl)phenyl)-4-(4-(pyrimidin-2-yl)piperazin-1-yl)pyrrolidin-2-one

ID: ALA5087100

PubChem CID: 166636321

Max Phase: Preclinical

Molecular Formula: C23H23FN6O

Molecular Weight: 418.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CC(N2CCN(c3ncccn3)CC2)CN1c1cccc(-c2cccnc2F)c1

Standard InChI:  InChI=1S/C23H23FN6O/c24-22-20(6-2-7-25-22)17-4-1-5-18(14-17)30-16-19(15-21(30)31)28-10-12-29(13-11-28)23-26-8-3-9-27-23/h1-9,14,19H,10-13,15-16H2

Standard InChI Key:  BAADUUTZIXTYBE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    1.3771  -24.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3759  -25.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0840  -26.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7936  -25.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7908  -24.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0822  -24.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4970  -24.5259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2444  -24.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7889  -24.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3776  -23.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5790  -23.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9694  -23.1662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6019  -24.3260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9344  -25.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7437  -25.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2251  -24.4966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8913  -23.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0761  -23.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0378  -24.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3661  -25.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1780  -25.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6592  -24.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3227  -24.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5118  -23.9240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0857  -26.9843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3762  -27.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3757  -28.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0838  -28.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7940  -28.2053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7910  -27.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4977  -26.9799    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  2  0
  9 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  3 25  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5087100

    ---

Associated Targets(non-human)

Mgll Monoglyceride lipase (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 418.48Molecular Weight (Monoisotopic): 418.1917AlogP: 2.61#Rotatable Bonds: 4
Polar Surface Area: 65.46Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.61CX LogP: 2.55CX LogD: 2.49
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -1.45

References

1. He Y, Schild M, Grether U, Benz J, Leibrock L, Heer D, Topp A, Collin L, Kuhn B, Wittwer M, Keller C, Gobbi LC, Schibli R, Mu L..  (2022)  Development of High Brain-Penetrant and Reversible Monoacylglycerol Lipase PET Tracers for Neuroimaging.,  65  (3.0): [PMID:35089028] [10.1021/acs.jmedchem.1c01706]

Source