2,6-difluoro-3-((1-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)decan-2-yl)oxy)benzamide

ID: ALA5087202

PubChem CID: 166633938

Max Phase: Preclinical

Molecular Formula: C23H27F2N5O5

Molecular Weight: 491.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCC(CNc1ccc([N+](=O)[O-])c2nonc12)Oc1ccc(F)c(C(N)=O)c1F

Standard InChI:  InChI=1S/C23H27F2N5O5/c1-2-3-4-5-6-7-8-14(34-18-12-9-15(24)19(20(18)25)23(26)31)13-27-16-10-11-17(30(32)33)22-21(16)28-35-29-22/h9-12,14,27H,2-8,13H2,1H3,(H2,26,31)

Standard InChI Key:  AYLDHTQGZQXWDL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   17.6100   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6089   -6.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3200   -6.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0371   -6.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0342   -5.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3183   -5.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3154   -4.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0292   -4.0691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6032   -4.0735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7477   -5.3086    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.8948   -5.3150    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.7528   -6.9657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4672   -6.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1829   -6.9634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8973   -6.5478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6130   -6.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6098   -7.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3247   -8.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0359   -7.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3207   -6.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0307   -6.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6361   -6.3958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2975   -5.6494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4831   -5.7421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7544   -8.1916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4679   -7.7786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7573   -9.0166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4659   -5.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1803   -5.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1790   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8934   -4.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8921   -3.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6065   -2.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6053   -2.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3197   -1.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7  9  2  0
  6  7  1  0
  5 10  1  0
  1 11  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 21  1  0
 20 16  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 20  2  0
 25 26  2  0
 25 27  1  0
 19 25  1  0
 13 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  CHG  2  25   1  27  -1
M  END

Alternative Forms

  1. Parent:

    ALA5087202

    ---

Associated Targets(non-human)

ftsZ Cell division protein FtsZ (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.50Molecular Weight (Monoisotopic): 491.1980AlogP: 5.12#Rotatable Bonds: 14
Polar Surface Area: 146.41Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.96CX Basic pKa: CX LogP: 5.12CX LogD: 5.12
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -0.92

References

1. Huecas S, Araújo-Bazán L, Ruiz FM, Ruiz-Ávila LB, Martínez RF, Escobar-Peña A, Artola M, Vázquez-Villa H, Martín-Fontecha M, Fernández-Tornero C, López-Rodríguez ML, Andreu JM..  (2021)  Targeting the FtsZ Allosteric Binding Site with a Novel Fluorescence Polarization Screen, Cytological and Structural Approaches for Antibacterial Discovery.,  64  (9.0): [PMID:33908781] [10.1021/acs.jmedchem.0c02207]

Source