The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
biphenyl-3,3',4,4',5,5'-hexakisphosphate ID: ALA5087243
PubChem CID: 118987001
Max Phase: Preclinical
Molecular Formula: C12H16O24P6
Molecular Weight: 730.08
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)Oc1cc(-c2cc(OP(=O)(O)O)c(OP(=O)(O)O)c(OP(=O)(O)O)c2)cc(OP(=O)(O)O)c1OP(=O)(O)O
Standard InChI: InChI=1S/C12H16O24P6/c13-37(14,15)31-7-1-5(2-8(32-38(16,17)18)11(7)35-41(25,26)27)6-3-9(33-39(19,20)21)12(36-42(28,29)30)10(4-6)34-40(22,23)24/h1-4H,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)
Standard InChI Key: XJTGIQJLTGTMQT-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
31.6022 -6.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0149 -6.7728 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
32.4233 -6.0604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3470 -6.0670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7597 -6.7769 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
28.1682 -6.0645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1767 -6.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4687 -7.1881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0533 -7.1871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1783 -1.1432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5910 -1.8531 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
30.9994 -1.1408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8873 -3.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8849 -2.2655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3003 -2.2613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4276 -4.1933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0232 -3.4834 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
31.6101 -4.1907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0037 -9.1294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5993 -8.4195 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
30.1862 -9.1268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1601 -4.2056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7515 -3.4958 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
27.3425 -4.2030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1781 -3.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1769 -4.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8891 -4.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6029 -4.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6001 -3.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8908 -5.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1772 -5.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8890 -7.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6032 -6.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6003 -5.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3104 -3.0767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4662 -3.0832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8898 -8.0109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0466 -3.0835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7299 -3.0714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3135 -8.0094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3118 -7.1839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7272 -7.1811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
8 5 1 0
5 9 2 0
11 10 1 0
12 11 1 0
13 14 1 0
14 11 1 0
11 15 2 0
17 16 1 0
18 17 1 0
20 19 1 0
21 20 1 0
23 22 1 0
24 23 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 13 2 0
13 25 1 0
30 31 2 0
31 7 1 0
7 32 2 0
32 33 1 0
33 34 2 0
34 30 1 0
27 30 1 0
29 35 1 0
25 36 1 0
32 37 1 0
35 17 1 0
37 20 1 0
36 23 1 0
23 38 2 0
17 39 2 0
20 40 2 0
33 41 1 0
41 2 1 0
2 42 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 730.08Molecular Weight (Monoisotopic): 729.8457AlogP: 0.18#Rotatable Bonds: 13Polar Surface Area: 400.56Molecular Species: ACIDHBA: 12HBD: 12#RO5 Violations: 3HBA (Lipinski): 24HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.10CX Basic pKa: ┄CX LogP: -2.12CX LogD: -14.86Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: 0.40
References 1. Whitfield H, Hemmings AM, Mills SJ, Baker K, White G, Rushworth S, Riley AM, Potter BVL, Brearley CA.. (2021) Allosteric Site on SHIP2 Identified Through Fluorescent Ligand Screening and Crystallography: A Potential New Target for Intervention., 64 (7.0): [PMID:33724834 ] [10.1021/acs.jmedchem.0c01944 ]