biphenyl-3,3',4,4',5,5'-hexakisphosphate

ID: ALA5087243

PubChem CID: 118987001

Max Phase: Preclinical

Molecular Formula: C12H16O24P6

Molecular Weight: 730.08

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=P(O)(O)Oc1cc(-c2cc(OP(=O)(O)O)c(OP(=O)(O)O)c(OP(=O)(O)O)c2)cc(OP(=O)(O)O)c1OP(=O)(O)O

Standard InChI:  InChI=1S/C12H16O24P6/c13-37(14,15)31-7-1-5(2-8(32-38(16,17)18)11(7)35-41(25,26)27)6-3-9(33-39(19,20)21)12(36-42(28,29)30)10(4-6)34-40(22,23)24/h1-4H,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)

Standard InChI Key:  XJTGIQJLTGTMQT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 42 43  0  0  0  0  0  0  0  0999 V2000
   31.6022   -6.0629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0149   -6.7728    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   32.4233   -6.0604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3470   -6.0670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7597   -6.7769    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   28.1682   -6.0645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1767   -6.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4687   -7.1881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0533   -7.1871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1783   -1.1432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5910   -1.8531    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   30.9994   -1.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8873   -3.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8849   -2.2655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3003   -2.2613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4276   -4.1933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0232   -3.4834    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   31.6101   -4.1907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0037   -9.1294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5993   -8.4195    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   30.1862   -9.1268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1601   -4.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7515   -3.4958    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   27.3425   -4.2030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1781   -3.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1769   -4.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8891   -4.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6029   -4.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6001   -3.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8908   -5.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1772   -5.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8890   -7.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6032   -6.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6003   -5.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3104   -3.0767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4662   -3.0832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8898   -8.0109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0466   -3.0835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7299   -3.0714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3135   -8.0094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3118   -7.1839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7272   -7.1811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  1  0
  8  5  1  0
  5  9  2  0
 11 10  1  0
 12 11  1  0
 13 14  1  0
 14 11  1  0
 11 15  2  0
 17 16  1  0
 18 17  1  0
 20 19  1  0
 21 20  1  0
 23 22  1  0
 24 23  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 13  2  0
 13 25  1  0
 30 31  2  0
 31  7  1  0
  7 32  2  0
 32 33  1  0
 33 34  2  0
 34 30  1  0
 27 30  1  0
 29 35  1  0
 25 36  1  0
 32 37  1  0
 35 17  1  0
 37 20  1  0
 36 23  1  0
 23 38  2  0
 17 39  2  0
 20 40  2  0
 33 41  1  0
 41  2  1  0
  2 42  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5087243

    ---

Associated Targets(Human)

INPPL1 Tchem Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 (180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 730.08Molecular Weight (Monoisotopic): 729.8457AlogP: 0.18#Rotatable Bonds: 13
Polar Surface Area: 400.56Molecular Species: ACIDHBA: 12HBD: 12
#RO5 Violations: 3HBA (Lipinski): 24HBD (Lipinski): 12#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.10CX Basic pKa: CX LogP: -2.12CX LogD: -14.86
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: 0.40

References

1. Whitfield H, Hemmings AM, Mills SJ, Baker K, White G, Rushworth S, Riley AM, Potter BVL, Brearley CA..  (2021)  Allosteric Site on SHIP2 Identified Through Fluorescent Ligand Screening and Crystallography: A Potential New Target for Intervention.,  64  (7.0): [PMID:33724834] [10.1021/acs.jmedchem.0c01944]

Source