The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-((1R,4R,6S)-2-Azabicydo[2.2.1]heptan-6-yl)phenyl)-7-(4-(trifluoromethyl)phenyl)-2-naphthoic Acid ID: ALA5087295
PubChem CID: 164585652
Max Phase: Preclinical
Molecular Formula: C30H24F3NO2
Molecular Weight: 487.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(-c2ccc([C@@H]3C[C@H]4CN[C@@H]3C4)cc2)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2c1
Standard InChI: InChI=1S/C30H24F3NO2/c31-30(32,33)24-8-5-18(6-9-24)21-7-10-25-22(13-21)14-23(29(35)36)15-26(25)19-1-3-20(4-2-19)27-11-17-12-28(27)34-16-17/h1-10,13-15,17,27-28,34H,11-12,16H2,(H,35,36)/t17-,27+,28-/m1/s1
Standard InChI Key: GVISRHKXWJRZIX-IIRCXYRXSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
25.4774 -3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4763 -4.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1890 -5.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1872 -3.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9006 -3.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9014 -4.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6146 -5.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3277 -4.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3230 -3.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6091 -3.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0329 -3.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7478 -3.9007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0279 -2.6710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7670 -3.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7681 -2.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0563 -2.2741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3431 -2.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3459 -3.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0581 -3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6299 -2.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6286 -1.4527 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9181 -2.6878 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9139 -1.8632 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.6154 -5.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9022 -6.3822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9035 -7.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6174 -7.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3313 -7.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3265 -6.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6202 -8.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9074 -8.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9083 -9.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6203 -10.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3340 -8.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3343 -9.6627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5355 -9.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0438 -8.4239 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.4927 -10.3767 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 1 0
11 13 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
1 14 1 0
17 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
7 24 1 0
30 27 1 1
30 31 1 0
30 34 1 0
31 32 1 0
32 33 1 0
33 35 1 0
35 34 1 0
34 36 1 0
32 36 1 0
34 37 1 1
32 38 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.52Molecular Weight (Monoisotopic): 487.1759AlogP: 7.36#Rotatable Bonds: 4Polar Surface Area: 49.33Molecular Species: ZWITTERIONHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.91CX Basic pKa: 10.95CX LogP: 4.46CX LogD: 4.46Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: 0.12
References 1. Wen Z, Salmaso V, Jung YH, Phung NB, Gopinatth V, Shah Q, Patterson AT, Randle JCR, Chen Z, Salvemini D, Lieberman DI, Whitehead GS, Karcz TP, Cook DN, Jacobson KA.. (2022) Bridged Piperidine Analogues of a High Affinity Naphthalene-Based P2Y14 R Antagonist., 65 (4.0): [PMID:35113556 ] [10.1021/acs.jmedchem.1c01964 ]