The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(2-(5-chloro-2,4-dimethoxyphenylamino)-2-oxoethyl)-2,4-dioxo-1,2-dihydroquinazolin-3(4H)-yl)acetic acid ID: ALA5087297
Cas Number: 1052722-45-8
PubChem CID: 24896589
Max Phase: Preclinical
Molecular Formula: C20H18ClN3O7
Molecular Weight: 447.83
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(NC(=O)Cn2c(=O)n(CC(=O)O)c(=O)c3ccccc32)cc1Cl
Standard InChI: InChI=1S/C20H18ClN3O7/c1-30-15-8-16(31-2)13(7-12(15)21)22-17(25)9-23-14-6-4-3-5-11(14)19(28)24(20(23)29)10-18(26)27/h3-8H,9-10H2,1-2H3,(H,22,25)(H,26,27)
Standard InChI Key: GCBKYZIVRCZIQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-1.9234 3.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6378 3.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6378 2.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9234 1.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2089 2.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2089 3.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4943 1.8535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2200 2.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2201 3.0910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4944 3.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4944 4.3286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9346 3.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9346 4.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2202 4.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6491 4.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9345 1.8536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4942 1.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2202 0.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2203 -0.2089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9348 -0.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9346 1.0286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9348 -1.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6493 -1.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3638 -1.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3638 -0.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6493 -0.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6493 0.6161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3638 1.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0782 -1.8589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0782 -2.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6493 -2.6838 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 10 1 0
8 9 1 0
9 10 1 0
7 8 1 0
5 7 1 0
10 11 2 0
9 12 1 0
12 13 1 0
13 15 2 0
13 14 1 0
8 16 2 0
7 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
20 22 2 0
26 20 1 0
26 27 1 0
27 28 1 0
24 29 1 0
29 30 1 0
23 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.83Molecular Weight (Monoisotopic): 447.0833AlogP: 1.56#Rotatable Bonds: 7Polar Surface Area: 128.86Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.00CX Basic pKa: ┄CX LogP: 1.51CX LogD: -1.96Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -1.48
References 1. Mammoliti O, Jansen K, El Bkassiny S, Palisse A, Triballeau N, Bucher D, Allart B, Jaunet A, Tricarico G, De Wachter M, Menet C, Blanc J, Letfus V, Rupčić R, Šmehil M, Poljak T, Coornaert B, Sonck K, Duys I, Waeckel L, Lecru L, Marsais F, Jagerschmidt C, Auberval M, Pujuguet P, Oste L, Borgonovi M, Wakselman E, Christophe T, Houvenaghel N, Jans M, Heckmann B, Sanière L, Brys R.. (2021) Discovery and Optimization of Orally Bioavailable Phthalazone and Cinnolone Carboxylic Acid Derivatives as S1P2 Antagonists against Fibrotic Diseases., 64 (19.0): [PMID:34581584 ] [10.1021/acs.jmedchem.1c01066 ]