N2-[(2-imidazol-1-ylphenyl)methyl]-N4,N4,5-trimethyl-pyrimidine-2,4-diamine

ID: ALA5087322

PubChem CID: 50983482

Max Phase: Preclinical

Molecular Formula: C17H20N6

Molecular Weight: 308.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cnc(NCc2ccccc2-n2ccnc2)nc1N(C)C

Standard InChI:  InChI=1S/C17H20N6/c1-13-10-19-17(21-16(13)22(2)3)20-11-14-6-4-5-7-15(14)23-9-8-18-12-23/h4-10,12H,11H2,1-3H3,(H,19,20,21)

Standard InChI Key:  KVEOZGZPAVUHBK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -3.2145    0.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5000    0.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881    0.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881   -0.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4982   -0.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2145   -0.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734    0.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3589    0.2905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3557    0.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3560    1.5283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0688    1.9390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837    1.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7852    0.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0734    0.2887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4983    1.9389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4999    0.2926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2145    0.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4999   -0.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734   -0.9472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3200   -0.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2319   -1.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1805   -1.9390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9872   -1.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 19  4  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
M  END

Associated Targets(Human)

HTR5A Tchem Serotonin 5a (5-HT5a) receptor (1433 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.39Molecular Weight (Monoisotopic): 308.1749AlogP: 2.65#Rotatable Bonds: 5
Polar Surface Area: 58.87Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.99CX LogP: 2.90CX LogD: 2.74
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: -2.04

References

1. Levit Kaplan A, Strachan RT, Braz JM, Craik V, Slocum S, Mangano T, Amabo V, O'Donnell H, Lak P, Basbaum AI, Roth BL, Shoichet BK..  (2022)  Structure-Based Design of a Chemical Probe Set for the 5-HT5A Serotonin Receptor.,  65  (5.0): [PMID:35195401] [10.1021/acs.jmedchem.1c02031]

Source