(S)-N-(2-((4aS,5aR)-5,5-difluoro-5a-methyl-1,4,4a,5,5a,6-hexahydrocyclopropa[f]indazol-3-yl)-6-methyl-1H-benzo[d]imidazol-5-yl)-N-methyl-2-morpholinopropanamide

ID: ALA5087453

PubChem CID: 156494869

Max Phase: Preclinical

Molecular Formula: C25H30F2N6O2

Molecular Weight: 484.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc2[nH]c(-c3n[nH]c4c3C[C@@H]3C(F)(F)[C@]3(C)C4)nc2cc1N(C)C(=O)[C@H](C)N1CCOCC1

Standard InChI:  InChI=1S/C25H30F2N6O2/c1-13-9-16-17(11-19(13)32(4)23(34)14(2)33-5-7-35-8-6-33)29-22(28-16)21-15-10-20-24(3,25(20,26)27)12-18(15)30-31-21/h9,11,14,20H,5-8,10,12H2,1-4H3,(H,28,29)(H,30,31)/t14-,20-,24+/m0/s1

Standard InChI Key:  PWTZWYZDFORBCV-OSZRXVRWSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   10.9992  -25.8238    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.4183  -25.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2057  -26.0364    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0663  -22.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0663  -23.0938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7795  -23.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4926  -23.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4926  -22.2680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7795  -21.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2094  -21.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9239  -22.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6406  -21.8594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9214  -23.0979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3550  -22.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6430  -21.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3513  -23.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0648  -23.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0682  -21.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7783  -22.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7795  -23.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5661  -23.3567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0528  -22.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5641  -22.0178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6340  -23.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8781  -22.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1499  -22.2678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3641  -22.0112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1512  -23.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3674  -23.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1932  -24.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7608  -23.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5879  -24.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8090  -24.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3934  -25.4131    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2979  -24.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2031  -21.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 12 15  1  0
 14 16  2  0
 16 17  1  0
 17 20  2  0
 19 18  2  0
 18 14  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 16 24  1  0
 25 29  1  0
 28 26  1  0
 26 27  1  0
 27 25  2  0
 22 25  1  0
 28 29  2  0
 28 31  1  0
 29 30  1  0
 30 33  1  0
 32 31  1  0
 33 32  1  0
  2 33  1  0
 32  2  1  0
 33 34  1  6
 32 35  1  6
 10 36  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5087453

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NTRK1 Tclin Nerve growth factor receptor Trk-A (7922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.55Molecular Weight (Monoisotopic): 484.2398AlogP: 3.31#Rotatable Bonds: 4
Polar Surface Area: 90.14Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.44CX Basic pKa: 5.51CX LogP: 3.08CX LogD: 3.07
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.59Np Likeness Score: -1.12

References

1. Abdel-Magid AF..  (2021)  Dual Inhibition of IL-2-Inducible T-Cell Kinase (ITK) and Tropomyosin Receptor Kinase A (TRKA) as Potential Treatment for Atopic Dermatitis and Other Inflammatory and Autoimmune Diseases.,  12  (12.0): [PMID:34917248] [10.1021/acsmedchemlett.1c00619]

Source