1-(5-bromo-8-quinolyl)-N-[(1-methylsulfonylcyclopropyl)methyl]methanamine

ID: ALA5087602

PubChem CID: 166631996

Max Phase: Preclinical

Molecular Formula: C15H17BrN2O2S

Molecular Weight: 369.28

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)C1(CNCc2ccc(Br)c3cccnc23)CC1

Standard InChI:  InChI=1S/C15H17BrN2O2S/c1-21(19,20)15(6-7-15)10-17-9-11-4-5-13(16)12-3-2-8-18-14(11)12/h2-5,8,17H,6-7,9-10H2,1H3

Standard InChI Key:  ZCUCFZYHBWLLTG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   -1.7840    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0720    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0720    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7822   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    0.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2130   -0.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2032   -1.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7779   -1.0271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4896   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3562    0.2066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0704   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4988   -0.2057    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.2130    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4988   -1.0303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846   -0.6180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1977    0.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3731    0.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2127    1.4437    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  2  6  1  0
  6  7  1  0
  8  7  2  0
  5  9  1  0
 10  9  2  0
 10  8  1  0
  4 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 15 18  2  0
 14 19  1  0
 19 20  1  0
 14 20  1  0
  2 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5087602

    ---

Associated Targets(Human)

HTR5A Tchem Serotonin 5a (5-HT5a) receptor (1433 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 369.28Molecular Weight (Monoisotopic): 368.0194AlogP: 2.66#Rotatable Bonds: 5
Polar Surface Area: 59.06Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.10CX LogP: 1.83CX LogD: 1.06
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.88Np Likeness Score: -0.90

References

1. Levit Kaplan A, Strachan RT, Braz JM, Craik V, Slocum S, Mangano T, Amabo V, O'Donnell H, Lak P, Basbaum AI, Roth BL, Shoichet BK..  (2022)  Structure-Based Design of a Chemical Probe Set for the 5-HT5A Serotonin Receptor.,  65  (5.0): [PMID:35195401] [10.1021/acs.jmedchem.1c02031]

Source