5-(Hydroxymethyl)-5-((5-phenyl-2H-tetrazol-2-yl)methyl)-3-(propan-2-ylidene)dihydrofuran-2(3H)-one

ID: ALA5088634

PubChem CID: 166632944

Max Phase: Preclinical

Molecular Formula: C16H18N4O3

Molecular Weight: 314.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)=C1CC(CO)(Cn2nnc(-c3ccccc3)n2)OC1=O

Standard InChI:  InChI=1S/C16H18N4O3/c1-11(2)13-8-16(10-21,23-15(13)22)9-20-18-14(17-19-20)12-6-4-3-5-7-12/h3-7,21H,8-10H2,1-2H3

Standard InChI Key:  VSZHECJPUBSTLS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    1.1500  -17.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9749  -17.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5661  -16.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2290  -17.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0540  -17.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3109  -17.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6415  -16.6663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0958  -16.8992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5382  -18.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2017  -19.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7297  -17.8578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9821  -15.7207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7996  -15.6387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9753  -14.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2629  -14.4165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6471  -14.9655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7278  -14.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3929  -14.9926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1477  -14.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2386  -13.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5686  -13.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8165  -13.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3588  -18.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  2  4  1  0
  6  8  2  0
  5  9  2  0
  9 10  1  0
  1 11  1  0
  3 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 17  1  0
  9 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5088634

    ---

Associated Targets(Human)

PRKCE Tchem Protein kinase C epsilon (1520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCA Tchem Protein kinase C alpha (5923 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.35Molecular Weight (Monoisotopic): 314.1379AlogP: 1.35#Rotatable Bonds: 4
Polar Surface Area: 90.13Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.78CX LogD: 2.78
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.68Np Likeness Score: -0.20

References

1. Elhalem E, Bellomo A, Cooke M, Scravaglieri A, Pearce LV, Peach ML, Gandolfi Donadío L, Kazanietz MG, Comin MJ..  (2021)  Design, Synthesis, and Characterization of Novel sn-1 Heterocyclic DAG-Lactones as PKC Activators.,  64  (15.0): [PMID:34279947] [10.1021/acs.jmedchem.1c00739]

Source