The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
alpha-toxicarol ID: ALA508992
Cas Number: 82-09-7
PubChem CID: 442826
Max Phase: Preclinical
Molecular Formula: C23H22O7
Molecular Weight: 410.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Alpha-Toxicarol | Toxicarol | alpha-Toxicarol|TOXICAROL|82-09-7|CHEBI:9643|(1S,14S)-11-hydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-one|CHEMBL508992|SCHEMBL4742046|HY-N7563|LMPK12060027|AKOS032949012|CS-0133854|Q27108457
Canonical SMILES: COc1cc2c(cc1OC)[C@@H]1C(=O)c3c(O)cc4c(c3O[C@@H]1CO2)C=CC(C)(C)O4
Standard InChI: InChI=1S/C23H22O7/c1-23(2)6-5-11-15(30-23)8-13(24)20-21(25)19-12-7-16(26-3)17(27-4)9-14(12)28-10-18(19)29-22(11)20/h5-9,18-19,24H,10H2,1-4H3/t18-,19+/m1/s1
Standard InChI Key: JLTNCZQNGBLBGO-MOPGFXCFSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
7.4710 -11.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1865 -12.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9008 -11.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8996 -11.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6132 -12.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6155 -10.7283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3337 -11.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3302 -11.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7631 -11.1521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0479 -10.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7597 -11.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0416 -12.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0328 -13.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7413 -13.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4602 -13.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4655 -12.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4721 -11.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1822 -10.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1829 -9.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4752 -9.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7653 -9.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7629 -10.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3263 -10.3179 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.3221 -12.7952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6123 -13.2126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5478 -9.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9638 -10.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1725 -13.6331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1669 -14.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7339 -14.4494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0151 -14.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1882 -13.2150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 8 1 0
14 15 1 0
7 6 1 0
15 16 2 0
16 11 1 0
17 18 1 0
7 8 1 0
3 18 2 0
3 4 1 0
17 1 2 0
7 10 1 0
17 22 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
8 12 1 0
7 23 1 1
11 9 1 0
8 24 1 1
9 10 1 0
5 25 2 0
1 2 1 0
21 26 1 0
2 4 2 0
21 27 1 0
11 12 2 0
15 28 1 0
3 6 1 0
28 29 1 0
12 13 1 0
14 30 1 0
4 5 1 0
30 31 1 0
13 14 2 0
2 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.42Molecular Weight (Monoisotopic): 410.1366AlogP: 3.71#Rotatable Bonds: 2Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.87CX Basic pKa: ┄CX LogP: 3.65CX LogD: 3.64Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.81Np Likeness Score: 2.60
References 1. Jang DS, Park EJ, Kang YH, Hawthorne ME, Vigo JS, Graham JG, Cabieses F, Fong HH, Mehta RG, Pezzuto JM, Kinghorn AD.. (2003) Potential cncer chemopreventive flavonoids from the stems of Tephrosia toxicaria., 66 (9): [PMID:14510590 ] [10.1021/np0302100 ] 2. Takashima J, Chiba N, Yoneda K, Ohsaki A.. (2002) Derrisin, a new rotenoid from Derris malaccensis plain and anti-Helicobacter pylori activity of its related constituents., 65 (4): [PMID:11975515 ] [10.1021/np010126p ] 3. Belmain SR, Amoah BA, Nyirenda SP, Kamanula JF, Stevenson PC.. (2012) Highly variable insect control efficacy of Tephrosia vogelii chemotypes., 60 (40): [PMID:22970736 ] [10.1021/jf3032217 ] 4. Muharini R, Díaz A, Ebrahim W, Mándi A, Kurtán T, Rehberg N, Kalscheuer R, Hartmann R, Orfali RS, Lin W, Liu Z, Proksch P.. (2017) Antibacterial and Cytotoxic Phenolic Metabolites from the Fruits of Amorpha fruticosa., 80 (1): [PMID:28075580 ] [10.1021/acs.jnatprod.6b00809 ]