(R)-1-(3-(2-fluoro-4-methylpyridin-3-yl)phenyl)-4-(4-(thiazole-2-carbonyl)piperazin-1-yl)pyrrolidin-2-one

ID: ALA5090045

PubChem CID: 165412132

Max Phase: Preclinical

Molecular Formula: C24H24FN5O2S

Molecular Weight: 465.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccnc(F)c1-c1cccc(N2C[C@H](N3CCN(C(=O)c4nccs4)CC3)CC2=O)c1

Standard InChI:  InChI=1S/C24H24FN5O2S/c1-16-5-6-26-22(25)21(16)17-3-2-4-18(13-17)30-15-19(14-20(30)31)28-8-10-29(11-9-28)24(32)23-27-7-12-33-23/h2-7,12-13,19H,8-11,14-15H2,1H3/t19-/m1/s1

Standard InChI Key:  BSDIMVPELJZNRU-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   14.9061   -9.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9050  -10.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6130  -10.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3227  -10.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3199   -9.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6112   -9.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0260   -9.1355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7734   -9.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3179   -8.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9067   -8.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1080   -8.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4984   -7.7758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1310   -8.9356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4634   -9.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2727   -9.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7542   -9.1062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4204   -8.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6051   -8.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5669   -9.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6147  -11.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9053  -12.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9047  -12.8181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6129  -13.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3230  -12.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3201  -11.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1981  -11.5922    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.0268  -11.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8993   -9.9382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0472   -8.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8603   -8.5265    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.1128   -7.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4517   -7.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7906   -7.7493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  2  0
  9 13  1  1
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  3 20  1  0
 21 26  1  0
 25 27  1  0
 19 28  2  0
 19 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5090045

    ---

Associated Targets(non-human)

Mgll Monoglyceride lipase (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 465.55Molecular Weight (Monoisotopic): 465.1635AlogP: 3.22#Rotatable Bonds: 4
Polar Surface Area: 69.64Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.38CX LogP: 2.54CX LogD: 2.53
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -1.29

References

1. He Y, Schild M, Grether U, Benz J, Leibrock L, Heer D, Topp A, Collin L, Kuhn B, Wittwer M, Keller C, Gobbi LC, Schibli R, Mu L..  (2022)  Development of High Brain-Penetrant and Reversible Monoacylglycerol Lipase PET Tracers for Neuroimaging.,  65  (3.0): [PMID:35089028] [10.1021/acs.jmedchem.1c01706]

Source