(R)-N-methyl-N-(2-((4aS,5aR)-5a-methyl-1,4,4a,5,5a,6-hexahydrocyclopropa[f]indazol-3-yl)-1H-benzo[d]imidazol-5-yl)-2-(tetrahydro-2H-pyran-4-yl)propanamide

ID: ALA5090091

PubChem CID: 156494903

Max Phase: Preclinical

Molecular Formula: C25H31N5O2

Molecular Weight: 433.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](C(=O)N(C)c1ccc2[nH]c(-c3n[nH]c4c3C[C@@H]3C[C@]3(C)C4)nc2c1)C1CCOCC1

Standard InChI:  InChI=1S/C25H31N5O2/c1-14(15-6-8-32-9-7-15)24(31)30(3)17-4-5-19-20(11-17)27-23(26-19)22-18-10-16-12-25(16,2)13-21(18)28-29-22/h4-5,11,14-16H,6-10,12-13H2,1-3H3,(H,26,27)(H,28,29)/t14-,16-,25-/m1/s1

Standard InChI Key:  DJGZDTXKQRIOFX-MJBQAUCRSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   28.4861   -1.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4861   -2.7776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1955   -3.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9049   -2.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9049   -1.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1955   -1.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6180   -1.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3286   -1.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0416   -1.5498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3262   -2.7818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7523   -1.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0440   -0.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7485   -2.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4583   -3.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4617   -1.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1680   -1.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1692   -2.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9518   -3.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4358   -2.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9498   -1.7074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2568   -2.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5220   -1.9561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7402   -1.7007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.5232   -2.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7435   -3.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5703   -3.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1296   -3.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9576   -4.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1828   -4.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7909   -4.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7695   -5.0847    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.6639   -4.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6117   -0.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
  9 12  1  0
 11 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 11  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 21 25  1  0
 24 22  1  0
 22 23  1  0
 23 21  2  0
 19 21  1  0
 24 25  2  0
 24 27  1  0
 25 26  1  0
 26 29  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 28 30  1  0
 29 31  1  6
 28 32  1  6
  7 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5090091

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NTRK1 Tclin Nerve growth factor receptor Trk-A (7922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.56Molecular Weight (Monoisotopic): 433.2478AlogP: 4.10#Rotatable Bonds: 4
Polar Surface Area: 86.90Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.20CX Basic pKa: 3.96CX LogP: 3.41CX LogD: 3.41
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -0.49

References

1. Abdel-Magid AF..  (2021)  Dual Inhibition of IL-2-Inducible T-Cell Kinase (ITK) and Tropomyosin Receptor Kinase A (TRKA) as Potential Treatment for Atopic Dermatitis and Other Inflammatory and Autoimmune Diseases.,  12  (12.0): [PMID:34917248] [10.1021/acsmedchemlett.1c00619]

Source