The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-((1-((4-Chloro-1H-indol-2-yl)methyl)-3,7-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)amino)-6-methylpyrimidin-2-yl)propanoic acid ID: ALA5090659
PubChem CID: 156026016
Max Phase: Preclinical
Molecular Formula: C24H23ClN8O4
Molecular Weight: 522.95
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Nc2nc3c(c(=O)n(Cc4cc5c(Cl)cccc5[nH]4)c(=O)n3C)n2C)nc(CCC(=O)O)n1
Standard InChI: InChI=1S/C24H23ClN8O4/c1-12-9-18(28-17(26-12)7-8-19(34)35)29-23-30-21-20(31(23)2)22(36)33(24(37)32(21)3)11-13-10-14-15(25)5-4-6-16(14)27-13/h4-6,9-10,27H,7-8,11H2,1-3H3,(H,34,35)(H,26,28,29,30)
Standard InChI Key: ILEKCBRCJDWEIR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.3799 -4.6959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0956 -5.1090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0953 -3.4599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3774 -3.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0954 -5.9341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6628 -3.4592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0968 -2.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8103 -3.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8056 -4.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5917 -4.9620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0824 -4.2948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5994 -3.6221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9075 -4.2995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8422 -5.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6638 -5.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9495 -4.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8643 -3.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1963 -5.0337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6444 -4.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0561 -3.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6458 -2.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8243 -2.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4146 -3.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8271 -4.4223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0583 -2.2845 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.3241 -3.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1465 -3.5963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5630 -2.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1545 -2.1670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3252 -2.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9124 -2.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9142 -1.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3881 -2.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8051 -2.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6301 -2.1832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0470 -1.4712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0383 -2.9002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 1 1 0
1 2 1 0
1 4 1 0
2 9 1 0
8 3 1 0
3 4 1 0
2 5 2 0
4 6 2 0
3 7 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
11 13 1 0
10 14 1 0
15 16 1 0
16 17 2 0
17 20 1 0
19 18 1 0
18 16 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
21 25 1 0
13 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
28 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.95Molecular Weight (Monoisotopic): 522.1531AlogP: 2.48#Rotatable Bonds: 7Polar Surface Area: 152.72Molecular Species: ACIDHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.17CX Basic pKa: 5.27CX LogP: 1.00CX LogD: -0.52Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.18
References 1. Lee LC, Peng YH, Chang HH, Hsu T, Lu CT, Huang CH, Hsueh CC, Kung FC, Kuo CC, Jiaang WT, Wu SY.. (2021) Xanthine Derivatives Reveal an Allosteric Binding Site in Methylenetetrahydrofolate Dehydrogenase 2 (MTHFD2)., 64 (15.0): [PMID:34337952 ] [10.1021/acs.jmedchem.1c00663 ]